475-80-9
Chemical Structure
Aristolochic acid B
Synonym(s): Aristolochic acid II
- CAS No.: 475-80-9
- Formula:C16H9NO6
- Molecular Weight:311.25
IUPAC Name: 6-nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylic acid
InChIKey: MEEXETVZNQYRSP-UHFFFAOYSA-N
SMILES: O=C(C1=C2C([N+]([O-])=O)=CC3=CC=CC=C3C2=C(OCO4)C4=C1)O
Biological Activity: Aristolochic acid B (Aristolochic Acid II) is an orally active major component of aristolochic acid (AA). Aristolochic acid B can be isolated from plants of the genus Aristolochica. Aristolochic acid B forms DNA adducts. Aristolochic acid B is mutagenic. Aristolochic acid B exhibits a greater carcinogenic risk in vivo than Aristolochic acid I (HY-N0510)[1][2][3].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Aristolochic acid B | 99.92% | Aristolochic acid B (Aristolochic Acid II) is an orally active major component of aristolochic acid (AA). Aristolochic acid B can be isolated from plants of the genus Aristolochica. Aristolochic acid B forms DNA adducts. Aristolochic acid B is mutagenic. Aristolochic acid B exhibits a greater carcinogenic risk in vivo than Aristolochic acid I (HY-N0510). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Aristolochic acid B (Standard) | ≥98% | Aristolochic acid B (Standard) is the analytical standard of Aristolochic acid B (HY-N0511). This product is intended for research and analytical applications. Aristolochic acid B (Aristolochic Acid II) is an orally active major component of aristolochic acid (AA). Aristolochic acid B can be isolated from plants of the genus Aristolochica. Aristolochic acid B forms DNA adducts. Aristolochic acid B is mutagenic. Aristolochic acid B exhibits a greater carcinogenic risk in vivo than Aristolochic acid I (HY-N0510). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Xing G, et al. Comparison of the mutagenicity of aristolochic acid I and aristolochic acid II in the gpt delta transgenic mouse kidney. Mutat Res. 2012 Mar 18;743(1-2):52-8. [Content Brief]
- [2]. Yeh YH, et al. Short-term toxicity of aristolochic acid, aristolochic acid-I and aristolochic acid-II in rats. Food Chem Toxicol. 2008 Mar;46(3):1157-63. [Content Brief]
- [3]. Schmeiser HH, et al. DNA adduct formation of aristolochic acid I and II in vitro and in vivo. Carcinogenesis. 1988 Feb;9(2):297-303. [Content Brief]