42571-07-3
Chemical Structure
2-Hydroxy-5-(2-nitrovinyl)benzoic acid
Synonym(s): SANA
- CAS. Nr.: 42571-07-3
- Formula:C9H7NO5
- Molecular Weight:209.16
IUPAC Name: (E)-2-hydroxy-5-(2-nitrovinyl)benzoic acid
InChIKey: NVWQBWPWSNPTBM-ONEGZZNKSA-N
SMILES: O=C(C1=CC(/C=C/[N+]([O-])=O)=CC=C1O)O
Biological Activity: 2-Hydroxy-5-(2-nitrovinyl) benzoic acid (SANA) is an orally active pleiotropic anti-inflammatory metabolic modulator. 2-Hydroxy-5-(2-nitrovinyl) benzoic acid inhibits NF-κB, activates Nrf2/Keap1 and AMPK, suppresses inflammasome activity, induces thermogenesis, reverses insulin resistance and alleviates skin graft rejection. 2-Hydroxy-5-(2-nitrovinyl) benzoic acid can be used in research related to obesity, glucose intolerance, skin graft rejection and insulin resistance[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
2-Hydroxy-5-(2-nitrovinyl)benzoic acid | 2-Hydroxy-5-(2-nitrovinyl) benzoic acid (SANA) is an orally active pleiotropic anti-inflammatory metabolic modulator. 2-Hydroxy-5-(2-nitrovinyl) benzoic acid inhibits NF-κB, activates Nrf2/Keap1 and AMPK, suppresses inflammasome activity, induces thermogenesis, reverses insulin resistance and alleviates skin graft rejection. 2-Hydroxy-5-(2-nitrovinyl) benzoic acid can be used in research related to obesity, glucose intolerance, skin graft rejection and insulin resistance. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||