1325559-13-4
Chemical Structure
Phenylbutazone-13C12
- CAS No.: 1325559-13-4
- Formula:C713C12H20N2O2
- Molecular Weight:320.29
IUPAC Name: 4-butyl-1,2-di(phenyl-13C6)pyrazolidine-3,5-dione
InChIKey: VYMDGNCVAMGZFE-ZDLJAUBWSA-N
SMILES: O=C1N([13C]2=[13CH][13CH]=[13CH][13CH]=[13CH]2)N([13C]3=[13CH][13CH]=[13CH][13CH]=[13CH]3)C(C1CCCC)=O
Biological Activity: Phenylbutazone-13C12 is the 13C12 labeled Phenylbutazone. Phenylbutazone is an efficient reducing cofactor for the peroxidase activity of prostaglandin H synthase (PHS). Phenylbutazone, a hepatotoxin, is a nonsteroidal anti-inflammatory agent (NSAID). Phenylbutazone induces muscle blind-like protein 1 (MBNL1) expression and has the potential for ankylosing spondylitis research.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Phenylbutazone-13C12 | 99.90% | Phenylbutazone-13C12 is the 13C12 labeled Phenylbutazone. Phenylbutazone is an efficient reducing cofactor for the peroxidase activity of prostaglandin H synthase (PHS). Phenylbutazone, a hepatotoxin, is a nonsteroidal anti-inflammatory agent (NSAID). Phenylbutazone induces muscle blind-like protein 1 (MBNL1) expression and has the potential for ankylosing spondylitis research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Phenylbutazone (Standard) | ≥98% | Phenylbutazone (Standard) is the analytical standard of Phenylbutazone. This product is intended for research and analytical applications. Phenylbutazone is an efficient reducing cofactor for the peroxidase activity of prostaglandin H synthase (PHS). Phenylbutazone, a hepatotoxin, is a nonsteroidal anti-inflammatory agent (NSAID). Phenylbutazone induces muscle blind-like protein 1 (MBNL1) expression and has the potential for ankylosing spondylitis research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Phenylbutazone(diphenyl-d10) | 99.90% | Phenylbutazone(diphenyl-d10) is the deuterium labeled Phenylbutazone. Phenylbutazone is an efficient reducing cofactor for the peroxidase activity of prostaglandin H synthase (PHS). Phenylbutazone, a hepatotoxin, is a nonsteroidal anti-inflammatory agent (NSAID). Phenylbutazone induces muscle blind-like protein 1 (MBNL1) expression and has the potential for ankylosing spondylitis research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Phenylbutazone-d9 | Phenylbutazone-d9 is the deuterium labeled Phenylbutazone. Phenylbutazone is an efficient reducing cofactor for the peroxidase activity of prostaglandin H synthase (PHS). Phenylbutazone, a hepatotoxin, is a nonsteroidal anti-inflammatory agent (NSAID). Phenylbutazone induces muscle blind-like protein 1 (MBNL1) expression and has the potential for ankylosing spondylitis research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Phenylbutazone | 99.69% | Phenylbutazone is an efficient reducing cofactor for the peroxidase activity of prostaglandin H synthase (PHS). Phenylbutazone, a hepatotoxin, is a nonsteroidal anti-inflammatory agent (NSAID). Phenylbutazone induces muscle blind-like protein 1 (MBNL1) expression and has the potential for ankylosing spondylitis research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
