1346603-41-5
Chemical Structure
N-Nitrosodiethylamine-d4
Synonym(s): Diethylnitrosamine-d4; DEN-d4; DENA-d4
- CAS No.: 1346603-41-5
- Formula:C4H6D4N2O
- Molecular Weight:106.16
IUPAC Name: N,N-bis(ethyl-1,1-d2)nitrous amide
InChIKey: WBNQDOYYEUMPFS-KHORGVISSA-N
SMILES: CC([2H])([2H])N(N=O)C([2H])([2H])C
Biological Activity: N-Nitrosodiethylamine-d4 is the deuterium labeled N-Nitrosodiethylamine[1]. N-Nitrosodiethylamine (Diethylnitrosamine) is a potent hepatocarcinogenic dialkylnitrosoamine. N-Nitrosodiethylamine is mainly present in tobacco smoke, water, cheddar cheese, cured, fried meals and many alcoholic beverages. N-Nitrosodiethylamine is responsible for the changes in the nuclear enzymes associated with DNA repair/replication. N-Nitrosodiethylamine results in various tumors in all animal species. The main target organs are the nasal cavity, trachea, lung, esophagus and liver.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N-Nitrosodiethylamine-d4 | N-Nitrosodiethylamine-d4 is the deuterium labeled N-Nitrosodiethylamine. N-Nitrosodiethylamine (Diethylnitrosamine) is a potent hepatocarcinogenic dialkylnitrosoamine. N-Nitrosodiethylamine is mainly present in tobacco smoke, water, cheddar cheese, cured, fried meals and many alcoholic beverages. N-Nitrosodiethylamine is responsible for the changes in the nuclear enzymes associated with DNA repair/replication. N-Nitrosodiethylamine results in various tumors in all animal species. The main target organs are the nasal cavity, trachea, lung, esophagus and liver. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
N-Nitrosodiethylamine (Standard) | 99.98% | N-Nitrosodiethylamine (Standard) is the analytical standard of N-Nitrosodiethylamine. This product is intended for research and analytical applications. N-Nitrosodiethylamine (Diethylnitrosamine) is a potent hepatocarcinogenic dialkylnitrosoamine. N-Nitrosodiethylamine is mainly present in tobacco smoke, water, cheddar cheese, cured, fried meals and many alcoholic beverages. N-Nitrosodiethylamine is responsible for the changes in the nuclear enzymes associated with DNA repair/replication. N-Nitrosodiethylamine results in various tumors in all animal species. The main target organs are the nasal cavity, trachea, lung, esophagus and liver. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
N-Nitrosodiethylamine-d10 | 99.90% | N-Nitrosodiethylamine-d10 is the deuterium labeled N-Nitrosodiethylamine. N-Nitrosodiethylamine (Diethylnitrosamine) is a potent hepatocarcinogenic dialkylnitrosoamine. N-Nitrosodiethylamine is mainly present in tobacco smoke, water, cheddar cheese, cured, fried meals and many alcoholic beverages. N-Nitrosodiethylamine is responsible for the changes in the nuclear enzymes associated with DNA repair/replication. N-Nitrosodiethylamine results in various tumors in all animal species. The main target organs are the nasal cavity, trachea, lung, esophagus and liver. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
N-Nitrosodiethylamine | 99.98% | N-Nitrosodiethylamine (Diethylnitrosamine) is a potent hepatocarcinogenic dialkylnitrosoamine. N-Nitrosodiethylamine is mainly present in tobacco smoke, water, cheddar cheese, cured, fried meals and many alcoholic beverages. N-Nitrosodiethylamine is responsible for the changes in the nuclear enzymes associated with DNA repair/replication. N-Nitrosodiethylamine results in various tumors in all animal species. The main target organs are the nasal cavity, trachea, lung, esophagus and liver. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
