162681-53-0
Chemical Structure
(Z)-Onjisaponin B
Synonym(s): (Z)-Senegin III
- CAS No.: 162681-53-0
- Formula:C75H112O35
- Molecular Weight:1573.67
InChIKey: QSTBHNPMHXYCII-UDFDPKSRSA-N
SMILES: OC[C@]12[C@]3([C@@](CC=C1[C@@]4([H])[C@@](CC2)(CCC(C)(C4)C)C(O[C@H]5[C@@H]([C@H]([C@H]([C@H](O5)C)OC(/C=C\C6=CC=C(C=C6)OC)=O)O[C@H]7[C@@H]([C@@H]([C@H]([C@@H](O7)C)O)O)O)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O[C@H]9[C@@H]([C@H]([C@@H](CO9)O[C@@H]%10O[C@@H]([C@@H]([C@@H]([C@H]%10O)O)O)CO)O)O)O)O)=O)([H])[C@@]%11([C@@]([C@@](C)([C@H]([C@H](C%11)O)O[C@@H]%12O[C@@H]([C@H]([C@@H]([C@H]%12O)O)O)CO)C(O)=O)([H])CC3)C)C
Biological Activity: (Z)-Onjisaponin B ((Z)-Senegin III) is a derivative of Onjisaponin B (HY-N2099). Onjisaponin B is an orally active natural product derived from Polygala tenuifolia. Onjisaponin B inhibits NF-κB p65. Onjisaponin B enhances autophagy and accelerates the degradation of mutant α-synuclein and huntingtin. Onjisaponin B reduces β-amyloid (Aβ) production. Onjisaponin B reduces radiation-induced cell apoptosis. Onjisaponin B has anti-oxidant and anti-inflammatory activities. Onjisaponin B can be used for neurological disease and radiation injury study, and its metabolite tenuifolin (TF) can enter the brain through the BBB[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(Z)-Onjisaponin B | (Z)-Onjisaponin B ((Z)-Senegin III) is a derivative of Onjisaponin B (HY-N2099). Onjisaponin B is an orally active natural product derived from Polygala tenuifolia. Onjisaponin B inhibits NF-κB p65. Onjisaponin B enhances autophagy and accelerates the degradation of mutant α-synuclein and huntingtin. Onjisaponin B reduces β-amyloid (Aβ) production. Onjisaponin B reduces radiation-induced cell apoptosis. Onjisaponin B has anti-oxidant and anti-inflammatory activities. Onjisaponin B can be used for neurological disease and radiation injury study, and its metabolite tenuifolin (TF) can enter the brain through the BBB. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
