23666-24-2
Chemical Structure
N6-(4-Methoxybenzyl)adenosine
- CAS. Nr.: 23666-24-2
- Formula:C18H21N5O5
- Molecular Weight:387.39
IUPAC Name: (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-((4-methoxybenzyl)amino)-9H-purin-9-yl)tetrahydrofuran-3,4-diol
InChIKey: LZNPQLJNXKVMMY-SCFUHWHPSA-N
SMILES: O[C@H]1[C@@H](O)[C@H](N2C=NC3=C(NCC4=CC=C(OC)C=C4)N=CN=C32)O[C@@H]1CO
Biological Activity: N6-(4-Methoxybenzyl)adenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N6-(4-Methoxybenzyl)adenosine | N6-(4-Methoxybenzyl)adenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
N6-(4-Methoxybenzyl)adenosine-d3 | N6-(4-Methoxybenzyl)adenosine-d3 is deuterium labeled N6-(4-Methoxybenzyl)adenosine. N6-(4-Methoxybenzyl)adenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||