478529-56-5
Chemical Structure
DL-Glyceraldehyde-13C3
- CAS No.: 478529-56-5
- Formula:13C3H6O3
- Molecular Weight:93.06
InChIKey: MNQZXJOMYWMBOU-VMIGTVKRSA-N
SMILES: O[13CH2][13CH](O)[13CH]=O
Biological Activity: DL-Glyceraldehyde-13C3 is the 13C labled DL-Glyceraldehyde (HY-128748)[1]. DL-Glyceraldehyde is an organic compound.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DL-Glyceraldehyde-13C3 | DL-Glyceraldehyde-13C3 is the 13C labled DL-Glyceraldehyde (HY-128748). DL-Glyceraldehyde is an organic compound. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
DL-Glyceraldehyde (Standard) | ≥98% | DL-Glyceraldehyde (Standard) is the analytical standard of DL-Glyceraldehyde. This product is intended for research and analytical applications. DL-Glyceraldehyde is a bioactive substance involved in cellular energy metabolism and a key intermediate in sugar metabolism pathways (such as glycolysis and gluconeogenesis). During glycolysis, DL-Glyceraldehyde is converted by enzymes into other metabolites to provide energy for cells; during gluconeogenesis, DL-Glyceraldehyde participates in the synthesis of glucose as a precursor. In the field of medical research, DL-Glyceraldehyde can be used to study diseases related to sugar metabolism, such as diabetes, tumors, etc |
||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
DL-Glyceraldehyde-1-13C | DL-Glyceraldehyde-1-13C is the 13C labeled DL-Glyceraldehyde. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
DL-Glyceraldehyde-13C,d | DL-Glyceraldehyde-13C,d is the deuterium and 13C labeled DL-Glyceraldehyde. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
DL-Glyceraldehyde-2-13C | DL-Glyceraldehyde-2-13C is the 13C labeled DL-Glyceraldehyde. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
DL-Glyceraldehyde | 90.0% | DL-Glyceraldehyde is a bioactive substance involved in cellular energy metabolism and a key intermediate in sugar metabolism pathways (such as glycolysis and gluconeogenesis). During glycolysis, DL-Glyceraldehyde is converted by enzymes into other metabolites to provide energy for cells; during gluconeogenesis, DL-Glyceraldehyde participates in the synthesis of glucose as a precursor. In the field of medical research, DL-Glyceraldehyde can be used to study diseases related to sugar metabolism, such as diabetes, tumors, etc |
||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||