1046490-67-8
Chemical Structure
STA-2842
- CAS No.: 1046490-67-8
- Formula:C29H38N6O5
- Molecular Weight:550.65
IUPAC Name: 5-(2,4-dihydroxy-5-isopropylphenyl)-N-(2-morpholinoethyl)-4-(4-(morpholinomethyl)phenyl)-4H-1,2,4-triazole-3-carboxamide
InChIKey: IYRJEWRABXHJSC-UHFFFAOYSA-N
SMILES: O=C(C1=NN=C(N1C2=CC=C(CN3CCOCC3)C=C2)C4=C(O)C=C(O)C(C(C)C)=C4)NCCN5CCOCC5
Biological Activity: STA-2842 is an inhibitor of heat shock protein HSP90 with potential to inhibit autosomal dominant polycystic kidney disease (ADPKD). ADPKD is caused by inherited mutations in the PKD1 or PKD2 genes that abnormally activate multiple signaling proteins and pathways that regulate cell proliferation. STA-2842 can significantly reduce initial renal cyst formation and kidney growth in mice, and slow disease progression in mice with existing cysts.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
STA-2842 | STA-2842 is an inhibitor of heat shock protein HSP90 with potential to inhibit autosomal dominant polycystic kidney disease (ADPKD). ADPKD is caused by inherited mutations in the PKD1 or PKD2 genes that abnormally activate multiple signaling proteins and pathways that regulate cell proliferation. STA-2842 can significantly reduce initial renal cyst formation and kidney growth in mice, and slow disease progression in mice with existing cysts. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||