130756-15-9
Chemical Structure
Sarothralin G
- CAS No.: 130756-15-9
- Formula:C36H42O8
- Molecular Weight:602.71
IUPAC Name: (E)-2-(3-benzoyl-5-(3,7-dimethylocta-2,6-dien-1-yl)-2,4,6-trihydroxybenzyl)-3,5-dihydroxy-6-isobutyryl-4,4-dimethylcyclohexa-2,5-dien-1-one
InChIKey: SGRCMCINDHFZMR-LTGZKZEYSA-N
SMILES: O=C1C(CC2=C(O)C(C/C=C(C)/CC/C=C(C)\C)=C(O)C(C(C3=CC=CC=C3)=O)=C2O)=C(O)C(C)(C)C(O)=C1C(C(C)C)=O
Biological Activity: Sarothralin G is an antibacterial compound isolated from Hypericum japonicum Thunb. (Japanese spurfle). The structure of Sarothralin G contains phenolic and aromatic acid moieties and shows excellent antibacterial activity against Gram-positive bacteria such as Staphylococcus aureus, Bacillus subtilis and Nocardia spp., which is stronger than Sarothralen A, B and Saroaspidin A, B, C. Sarothralin G exhibits significant antibacterial potential.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Sarothralin G | Sarothralin G is an antibacterial compound isolated from Hypericum japonicum Thunb. (Japanese spurfle). The structure of Sarothralin G contains phenolic and aromatic acid moieties and shows excellent antibacterial activity against Gram-positive bacteria such as Staphylococcus aureus, Bacillus subtilis and Nocardia spp., which is stronger than Sarothralen A, B and Saroaspidin A, B, C. Sarothralin G exhibits significant antibacterial potential. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
