1397-89-3
1397-89-3
Chemical Structure
Amphotericin B
- CAS No.: 1397-89-3
- Formula:C47H73NO17
- Molecular Weight:924.08
IUPAC Name: (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-(((2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriac
InChIKey: APKFDSVGJQXUKY-INPOYWNPSA-N
SMILES: C[C@H]([C@@H](O)[C@@H](C)[C@H](C)OC1=O)/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](O[C@]2([H])O[C@H](C)[C@@H](O)[C@H](N)[C@@H]2O)C[C@@]3([H])[C@H](C(O)=O)[C@@H](O)C[C@](C[C@@H](O)C[C@@H](O)[C@H](O)CC[C@@H](O)C[C@@H](O)C1)(O)O3
Biological Activity: Amphotericin B is a polyene antifungal agent against a wide variety of fungal pathogens. It binds irreversibly to ergosterol, resulting in disruption of membrane integrity and ultimately cell death.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Amphotericin B | 93.31% | Amphotericin B is a polyene antifungal agent against a wide variety of fungal pathogens. It binds irreversibly to ergosterol, resulting in disruption of membrane integrity and ultimately cell death. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Amphotericin B (Standard) | 90.28% | Amphotericin B (Standard) is the analytical standard of Amphotericin B. This product is intended for research and analytical applications. Amphotericin B is a polyene antifungal agent against a wide variety of fungal pathogens. It binds irreversibly to ergosterol, resulting in disruption of membrane integrity and ultimately cell death. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Amphocil | Amphocil is an equimolar mixture of Amphotericin B (HY-B0221) and cholesteryl sulphate with antifungal effects. Amphocil is promising for research of disseminated cryptococcosis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Amphotericin B methyl ester | 83.37% | Amphotericin B methyl ester is the methyl ester derivative of the polyene antibiotic Amphotericin B (A634250). Amphotericin B methyl ester is the cholesterol-binding compound possesses significant antifungal activity. Amphotericin B methyl ester disrupts HIV-1 particle production and potently inhibits HIV-1 replication. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Amphotericin B methyl ester hydrochloride | Amphotericin B methyl ester hydrochloride is the methyl ester derivative of the polyene antibiotic Amphotericin B (A634250). Amphotericin B methyl ester hydrochloride is the cholesterol-binding compound possesses significant antifungal activity. Amphotericin B methyl ester hydrochloride disrupts HIV-1 particle production and potently inhibits HIV-1 replication. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Amphotericin X1 | Amphotericin X1 is an 13-O-methyl derivative of Amphotericin B with good antifungal activity. Amphotericin X1 inhibits Candida albicans 33/079, C.parapsilosis 937A, Cryptococcus neoformans 451, Aspergillus niger 57A and A.fumigatus with MIC values of 1 μg/mL, 8 μg/mL, 1 μg/mL, 2 μg/mL and 2 μg/mL, respectively. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Nystatin A2 | Nystatin A2 is an active component of antifungal agent, Nystatin (HY-17409). Nystatin is an orally active polyene antifungal antibiotic effective against yeast and mycoplasma. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Nystatin | 99.64% | Nystatin is an orally active polyene antifungal antibiotic effective against yeast and mycoplasma. Nystatin increases the permeability of plasma membranes to small monovalent ions, including chloridion. Nystatin is a cholesterol-sequestering agent, partially prevents Oxaliplatin-induced lipid raft aggregation, DR4 and DR5 clustering, and thereby reduces apoptosis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Candidin | Candidin is an antioxidant flavonoid, which can be found in the roots of Millettia brandisiana. Candidin induces cytotoxic activity in human cancer cells. Candidin mediates antioxidant activity via peroxyl radical scavenging. Candidin can be used for the research of liver cancer and lung cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Amphotericin B trihydrate | Amphotericin B trihydrate, a polyene antibiotic, is first isolated from fermenter cultures of Streptomyces nodosus. Amphotericin B trihydrate also possesses antileishmanial activity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
