1418561-41-7
Chemical Structure
Azide-PEG7-Tos
- CAS No.: 1418561-41-7
- Formula:C21H35N3O9S
- Molecular Weight:505.58
IUPAC Name: 20-azido-3,6,9,12,15,18-hexaoxaicosyl 4-methylbenzenesulfonate
InChIKey: UELWUEFVUUJRLG-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCOS(C1=CC=C(C)C=C1)(=O)=O
Biological Activity: Azide-PEG7-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azide-PEG7-Tos is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azide-PEG7-Tos | Azide-PEG7-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azide-PEG7-Tos is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||