1430741-35-7
Chemical Structure
CFI-401870
- CAS No.: 1430741-35-7
- Formula:C30H31N5O2
- Molecular Weight:493.60
IUPAC Name: N-((R)-cyclopropyl(pyridin-2-yl)methyl)-3-(4-((1R,3R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)phenyl)-1H-indazole-5-carboxamide
InChIKey: DUKJABPGWUISRC-CAFXQFFASA-N
SMILES: O[C@@H]1C[C@H](CC[C@@H]2C1)N2C3=CC=C(C=C3)C4=NNC5=C4C=C(C=C5)C(N[C@H](C6CC6)C7=NC=CC=C7)=O
Biological Activity: CFI-401870 is an orally active threonine tyrosine kinase (TTK (Mps1)) inhibitor with an IC50 of 3.1 nM. CFI-401870 exhibits IC50s against PLK4, KDR, AURKA and other kinases such as AURKB/INCENP were all greater than 1 μM.CFI-401870 inhibits the growth of various cancer cells, causing chromosome lag, an increase in aneuploidy and cell cycle arrest. CFI-401870 can be used for the study of cancers such as colon cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
CFI-401870 | CFI-401870 is an orally active threonine tyrosine kinase (TTK (Mps1)) inhibitor with an IC50 of 3.1 nM. CFI-401870 exhibits IC50s against PLK4, KDR, AURKA and other kinases such as AURKB/INCENP were all greater than 1 μM.CFI-401870 inhibits the growth of various cancer cells, causing chromosome lag, an increase in aneuploidy and cell cycle arrest. CFI-401870 can be used for the study of cancers such as colon cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
