167278-49-1
Chemical Structure
MBP Ac1-9 (4Y)
- CAS No.: 167278-49-1
- Formula:C47H75N17O16
- Molecular Weight:1134.20
InChIKey: QICAQKJDJNQNGW-WNSLIGOFSA-N
SMILES: O=C(N[C@@H](CO)C(N[C@@H](CCC(N)=O)C(N[C@@H](CC1=CC=C(C=C1)O)C(N[C@@H](CCCNC(N)=N)C(N2[C@@H](CCC2)C(N[C@@H](CO)C(N[C@@H](CCC(N)=O)C(N[C@@H](CCCNC(N)=N)C(O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](C)NC(C)=O
Biological Activity: MBP Ac1-9 (4Y) is a synthetic peptide derived from a fragment of myelin basic protein (MBP) that has undergone specific chemical modifications. MBP Ac1-9 (4Y) is able to form a complex with the MHC class II molecule I-Au and activate specific T cell receptor (TCR), thus playing a role in the pathogenesis of experimental autoimmune encephalomyelitis (EAE). MBP Ac1-9 (4Y) can be used to study autoimmune diseases, especially those involving the central nervous system, such as multiple sclerosis[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
MBP Ac1-9 (4Y) | MBP Ac1-9 (4Y) is a synthetic peptide derived from a fragment of myelin basic protein (MBP) that has undergone specific chemical modifications. MBP Ac1-9 (4Y) is able to form a complex with the MHC class II molecule I-Au and activate specific T cell receptor (TCR), thus playing a role in the pathogenesis of experimental autoimmune encephalomyelitis (EAE). MBP Ac1-9 (4Y) can be used to study autoimmune diseases, especially those involving the central nervous system, such as multiple sclerosis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
