1698019-88-3
Chemical Structure
Iodoacetamido-PEG8-acid
- CAS No.: 1698019-88-3
- Formula:C21H40INO11
- Molecular Weight:609.45
IUPAC Name: 1-iodo-2-oxo-6,9,12,15,18,21,24,27-octaoxa-3-azatriacontan-30-oic acid
InChIKey: DWBDYRWMFAYNIL-UHFFFAOYSA-N
SMILES: O=C(CCOCCOCCOCCOCCOCCOCCOCCOCCNC(CI)=O)O
Biological Activity: Iodoacetamido-PEG8-acid is a PEG reagent containing an Iodoacetamide group and a carboxlic acid moiety. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The iodoacetamide group is an alkylating agent that can be used to bind covalently with the thiol group.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Iodoacetamido-PEG8-acid | Iodoacetamido-PEG8-acid is a PEG reagent containing an Iodoacetamide group and a carboxlic acid moiety. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The iodoacetamide group is an alkylating agent that can be used to bind covalently with the thiol group. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||