1835700-14-5
Chemical Structure
AGD-0182
- CAS No.: 1835700-14-5
- Formula:C38H63N9O7
- Molecular Weight:757.96
IUPAC Name: (2S,3S)-N-((3R,4S,5S)-1-((S)-2-((1R,2R)-3-(((S)-1-amino-1-oxo-3-phenylpropan-2-yl)amino)-1-methoxy-2-methyl-3-oxopropyl)pyrrolidin-1-yl)-3-methoxy-5-methyl-1-oxoheptan-4-yl)-3-azido-N-methyl-2-((S)-3-methyl-2-(methylamino)butanamido)butanamide
InChIKey: TYROHBPOIIUEQF-HFQNRHNCSA-N
SMILES: CN[C@@H](C(C)C)C(N[C@@H]([C@H](C)N=[N+]=[N-])C(N(C)[C@@H]([C@@H](C)CC)[C@@H](CC(N1[C@@H](CCC1)[C@H](OC)[C@@H](C)C(N[C@H](C(N)=O)CC2=CC=CC=C2)=O)=O)OC)=O)=O
Biological Activity: AGD-0182 is a microtubule disrupting agent. AGD-0182 is a synthetic analogue of the naturally occurring tubulin-binding molecule Dolastatin 10[1]. AGD-0182 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
AGD-0182 | AGD-0182 is a microtubule disrupting agent. AGD-0182 is a synthetic analogue of the naturally occurring tubulin-binding molecule Dolastatin 10. AGD-0182 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
