18918-31-5
Chemical Structure
4-Nitrophenyl α-L-rhamnopyranoside
- CAS No.: 18918-31-5
- Formula:C12H15NO7
- Molecular Weight:285.25
IUPAC Name: (2S,3R,4R,5R,6S)-2-methyl-6-(4-nitrophenoxy)tetrahydro-2H-pyran-3,4,5-triol
InChIKey: YILIDCGSXCGACV-UOAXWKJLSA-N
SMILES: O[C@H]([C@@H]([C@H]1O)O)[C@@H](O[C@H]1C)OC(C=C2)=CC=C2[N+]([O-])=O
Biological Activity: 4-Nitrophenyl α-L-rhamnopyranoside is a commonly used substrate in various biochemical assays to measure the activity of enzymes that hydrolyze rhamnose, such as α-L-rhamnosidase. 4-Nitrophenyl α-L-rhamnopyranoside has unique chemical properties that allow it to be hydrolyzed by these enzymes to form a yellow product called p-nitrophenol. This makes it a useful tool for detecting and quantifying rhamnohydrolase activity in biological samples or microbial cultures.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
4-Nitrophenyl α-L-rhamnopyranoside | 99.83% | 4-Nitrophenyl α-L-rhamnopyranoside is a commonly used substrate in various biochemical assays to measure the activity of enzymes that hydrolyze rhamnose, such as α-L-rhamnosidase. 4-Nitrophenyl α-L-rhamnopyranoside has unique chemical properties that allow it to be hydrolyzed by these enzymes to form a yellow product called p-nitrophenol. This makes it a useful tool for detecting and quantifying rhamnohydrolase activity in biological samples or microbial cultures. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
