237425-37-5
Chemical Structure
Crocacin B
- CAS No.: 237425-37-5
- Formula:C30H40N2O6
- Molecular Weight:524.65
InChIKey: KSYRCWWRVVIIEX-XUBYDZNKSA-N
SMILES: CO[C@@H](/C=C/C1=CC=CC=C1)[C@@H](C)[C@@H](OC)[C@@H](C)/C=C/C(C)=C/C(N/C=C\C/C=C\C(NCC(O)=O)=O)=O
Biological Activity: Crocacin B has anti-yeast and filamentous fungal activity. Crocacin B can inhibit mouse fibroblasts L929. In the microsomes of the calf's heart, Crocacin B can interrupt the bc1 segment of electronic transmission, causes redshift of 569 nm peak in cytochrome B reduction spectrum[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Crocacin B | Crocacin B has anti-yeast and filamentous fungal activity. Crocacin B can inhibit mouse fibroblasts L929. In the microsomes of the calf's heart, Crocacin B can interrupt the bc1 segment of electronic transmission, causes redshift of 569 nm peak in cytochrome B reduction spectrum. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords