2566976-43-8
Chemical Structure
PRDX1-IN-2
- CAS No.: 2566976-43-8
- Formula:C35H48N2O5
- Molecular Weight:576.77
InChIKey: VRZYWQDMGPXURI-ZIMIRHEFSA-N
SMILES: O=C1C(O)=C(C2=CC=C3[C@](C)([C@]4(CC[C@]3(C2=C1)C)C)CC[C@@]5([C@]4(C[C@](NC(NC6(C(OC)=O)CCC6)=O)(CC5)C)[H])C)C
Biological Activity: PRDX1-IN-2 (compound 15) is a selective inhibitor of the antioxidant enzyme Peroxiredoxin 1 (PRDX1) (IC50=0.35 μM). PRDX1-IN-2 decreases the mitochondria membrane potential of SW620 cells, probably due to ROS induced by PRDX1 inhibition, leading to cell apoptosis. PRDX1-IN-2 can be used for colorectal cancer research[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
PRDX1-IN-2 | PRDX1-IN-2 (compound 15) is a selective inhibitor of the antioxidant enzyme Peroxiredoxin 1 (PRDX1) (IC50=0.35 μM). PRDX1-IN-2 decreases the mitochondria membrane potential of SW620 cells, probably due to ROS induced by PRDX1 inhibition, leading to cell apoptosis. PRDX1-IN-2 can be used for colorectal cancer research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||