3043908-63-7
Chemical Structure
PROTAC pan-KRAS degrader-1
- CAS No.: 3043908-63-7
- Formula:C63H71F2N13O7S
- Molecular Weight:1192.38
InChIKey: JELHLMJKGQYGFM-WIWIRLKUSA-N
SMILES: FC(C=C1)=C(CC)C(C1=CC(O)=C2)=C2C3=NC=C4C(N=C(OCC5(CC5)CN6CCC(OC7=NC=C(C8=CN([C@@H](C(C)C)C(N9C[C@H](O)C[C@H]9C(N[C@@H](C)C%10=CC=C(C%11=C(C)N=CS%11)C=C%10)=O)=O)N=N8)N=C7)CC6)N=C4N%12CCC[C@@](C)(O)C%12)=C3F
Biological Activity: PROTAC pan-KRAS degrader-1 is a pan-KRAS-targeting PROTAC degrader for degrading different KRAS mutation types, such as G12D, G12C, G12V, and G13D. PROTAC pan-KRAS degrader-1 potently degrades KRAS mutation (G12D) in AGS cells, with a DC50 of 1.1 nM, Dmax of 95%. PROTAC pan-KRAS degrader-1 can be used to search diseases caused by KRAS mutation or amplification, especially cancers such as breast cancer, bladder cancer, gastric cancer, etc[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
PROTAC pan-KRAS degrader-1 | PROTAC pan-KRAS degrader-1 is a pan-KRAS-targeting PROTAC degrader for degrading different KRAS mutation types, such as G12D, G12C, G12V, and G13D. PROTAC pan-KRAS degrader-1 potently degrades KRAS mutation (G12D) in AGS cells, with a DC50 of 1.1 nM, Dmax of 95%. PROTAC pan-KRAS degrader-1 can be used to search diseases caused by KRAS mutation or amplification, especially cancers such as breast cancer, bladder cancer, gastric cancer, etc. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||