352439-38-4
Chemical Structure
Azido-PEG6-MS
- CAS No.: 352439-38-4
- Formula:C13H27N3O8S
- Molecular Weight:385.43
IUPAC Name: 17-azido-3,6,9,12,15-pentaoxaheptadecyl methanesulfonate
InChIKey: VSSFOIKXGWLEBU-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOCCOCCOS(C)(=O)=O
Biological Activity: Azido-PEG6-MS is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG6-MS is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG6-MS | 95.32% | Azido-PEG6-MS is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG6-MS is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||