86073-88-3
Chemical Structure
Luteinizing Hormone Releasing Hormone (LH-RH), salmon
Synonym(s): Salmon GnRH; Salmon gonadotropin-releasing hormone; sGnRH
- CAS No.: 86073-88-3
- Formula:C60H73N15O13
- Molecular Weight:1212.31
IUPAC Name: (S)-N-(2-amino-2-oxoethyl)-1-(((S)-5-oxopyrrolidine-2-carbonyl)-L-histidyl-L-tryptophyl-L-seryl-L-tyrosylglycyl-L-tryptophyl-L-leucyl)pyrrolidine-2-carboxamide
InChIKey: NMJREATYWWNIKX-XJIZABAQSA-N
SMILES: O=C([C@H]1NC(CC1)=O)N[C@@H](CC2=CN=CN2)C(N[C@H](C(N[C@@H](CO)C(N[C@H](C(NCC(N[C@H](C(N[C@@H](CC(C)C)C(N3[C@@H](CCC3)C(NCC(N)=O)=O)=O)=O)CC4=CNC5=CC=CC=C45)=O)=O)CC6=CC=C(C=C6)O)=O)=O)CC7=CNC8=CC=CC=C78)=O
Biological Activity: Luteinizing Hormone Releasing Hormone (LH-RH), salmon (Salmon GnRH) is the hypophysiotropic decapeptide synthesized in the hypothalamus that plays a crucial role in the control of reproductive functions.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Luteinizing Hormone Releasing Hormone (LH-RH), salmon | 98.69% | Luteinizing Hormone Releasing Hormone (LH-RH), salmon (Salmon GnRH) is the hypophysiotropic decapeptide synthesized in the hypothalamus that plays a crucial role in the control of reproductive functions. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
