GPP78
Based on 1 publication(s) in Google Scholar
GPP78 (CAY10618) is a potent Nampt inhibitor with an IC50 of 3.0 nM for nicotinamide adenine dinucleotide (NAD) depletion. GPP78 is cytotoxic to neuroblastoma cell line SH-SY5Y cells with an IC50 of 3.8 nM by inducing autophagy. GPP78 has anti-cancer and anti-inflammatory effects.
For research use only. We do not sell to patients.
- Purity: 99.9%
- CAS No.: 1202580-59-3
- Formula: C27H29N5O
- Molecular Weight:439.55
-
Storage:
Solution, -20°C, 2 years
Publications Citing Use of MedChemExpress (MCE) GPP78
More
Biological Activity
Description
IC50 & Target
Cellular Effect
|
Cell Line
|
Type | Value | Description | References |
|---|---|---|---|---|
| 786-0 | GI50 |
7.33 μM
Compound: 8
|
Growth inhibition of human 786-0 cells by sulforhodamine B assay
Growth inhibition of human 786-0 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| 786-0 | GI50 |
7.33 x 10-6 M
Compound: 8
|
Growth inhibition of human 786-0 cells by sulforhodamine B assay
Growth inhibition of human 786-0 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| A498 | GI50 |
1.59 x 10-5 M
Compound: 8
|
Growth inhibition of human A498 cells by sulforhodamine B assay
Growth inhibition of human A498 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| A549 | GI50 |
2.1 μM
Compound: 8
|
Growth inhibition of human A549 cells by sulforhodamine B assay
Growth inhibition of human A549 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| A549 | GI50 |
2.1 x 10-6 M
Compound: 8
|
Growth inhibition of human A549 cells by sulforhodamine B assay
Growth inhibition of human A549 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| ACHN | GI50 |
1.87 x 10-5 M
Compound: 8
|
Growth inhibition of human ACHN cells by sulforhodamine B assay
Growth inhibition of human ACHN cells by sulforhodamine B assay
|
[PMID: 19961183] |
| BT-549 | GI50 |
1.7 μM
Compound: 8
|
Growth inhibition of human BT549 cells by sulforhodamine B assay
Growth inhibition of human BT549 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| BT-549 | GI50 |
1.7 x 10-6 M
Compound: 8
|
Growth inhibition of human BT549 cells by sulforhodamine B assay
Growth inhibition of human BT549 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| CAKI-1 | GI50 |
7.76 x 10-7 M
Compound: 8
|
Growth inhibition of human Caki1 cells by sulforhodamine B assay
Growth inhibition of human Caki1 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| CAKI-1 | GI50 |
7.76 x 10-1 μM
Compound: 8
|
Growth inhibition of human Caki1 cells by sulforhodamine B assay
Growth inhibition of human Caki1 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| CCRF-CEM | GI50 |
3.28 μM
Compound: 8
|
Growth inhibition of human CCRF-CEM cells by sulforhodamine B assay
Growth inhibition of human CCRF-CEM cells by sulforhodamine B assay
|
[PMID: 19961183] |
| CCRF-CEM | GI50 |
3.28 x 10-6 M
Compound: 8
|
Growth inhibition of human CCRF-CEM cells by sulforhodamine B assay
Growth inhibition of human CCRF-CEM cells by sulforhodamine B assay
|
[PMID: 19961183] |
| COLO 205 | GI50 |
1.18 μM
Compound: 8
|
Growth inhibition of human COLO205 cells by sulforhodamine B assay
Growth inhibition of human COLO205 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| COLO 205 | GI50 |
1.18 x 10-6 M
Compound: 8
|
Growth inhibition of human COLO205 cells by sulforhodamine B assay
Growth inhibition of human COLO205 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| DU-145 | GI50 |
7.02 x 10-7 M
Compound: 8
|
Growth inhibition of human DU145 cells by sulforhodamine B assay
Growth inhibition of human DU145 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| DU-145 | GI50 |
7.02 x 10-1 μM
Compound: 8
|
Growth inhibition of human DU145 cells by sulforhodamine B assay
Growth inhibition of human DU145 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| EKVX | GI50 |
8.46 μM
Compound: 8
|
Growth inhibition of human EKVX cells by sulforhodamine B assay
Growth inhibition of human EKVX cells by sulforhodamine B assay
|
[PMID: 19961183] |
| EKVX | GI50 |
8.46 x 10-6 M
Compound: 8
|
Growth inhibition of human EKVX cells by sulforhodamine B assay
Growth inhibition of human EKVX cells by sulforhodamine B assay
|
[PMID: 19961183] |
| HCC 2998 | GI50 |
7 x 10-7 M
Compound: 8
|
Growth inhibition of human HCC2998 cells by sulforhodamine B assay
Growth inhibition of human HCC2998 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| HCC 2998 | GI50 |
7 x 10-1 μM
Compound: 8
|
Growth inhibition of human HCC2998 cells by sulforhodamine B assay
Growth inhibition of human HCC2998 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| HCT-116 | GI50 |
4.03 x 10-8 M
Compound: 8
|
Growth inhibition of human HCT116 cells by sulforhodamine B assay
Growth inhibition of human HCT116 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| HCT-116 | GI50 |
4.03 x 10-2 μM
Compound: 8
|
Growth inhibition of human HCT116 cells by sulforhodamine B assay
Growth inhibition of human HCT116 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| HCT-15 | GI50 |
2.57 x 10-7 M
Compound: 8
|
Growth inhibition of human HCT15 cells by sulforhodamine B assay
Growth inhibition of human HCT15 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| HCT-15 | GI50 |
2.57 x 10-1 μM
Compound: 8
|
Growth inhibition of human HCT15 cells by sulforhodamine B assay
Growth inhibition of human HCT15 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| HOP-62 | GI50 |
2.38 x 10-5 M
Compound: 8
|
Growth inhibition of human HOP62 cells by sulforhodamine B assay
Growth inhibition of human HOP62 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| HOP-92 | GI50 |
9.74 x 10-5 M
Compound: 8
|
Growth inhibition of human HOP92 cells by sulforhodamine B assay
Growth inhibition of human HOP92 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| Hs-578T | GI50 |
2.04 x 10-5 M
Compound: 8
|
Growth inhibition of human Hs 578T cells by sulforhodamine B assay
Growth inhibition of human Hs 578T cells by sulforhodamine B assay
|
[PMID: 19961183] |
| HT-29 | GI50 |
4.6 x 10-7 M
Compound: 8
|
Growth inhibition of human HT-29 cells by sulforhodamine B assay
Growth inhibition of human HT-29 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| HT-29 | GI50 |
4.6 x 10-1 μM
Compound: 8
|
Growth inhibition of human HT-29 cells by sulforhodamine B assay
Growth inhibition of human HT-29 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| IGROV-1 | GI50 |
2.72 x 10-7 M
Compound: 8
|
Growth inhibition of human IGROV1 cells by sulforhodamine B assay
Growth inhibition of human IGROV1 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| IGROV-1 | GI50 |
2.72 x 10-1 μM
Compound: 8
|
Growth inhibition of human IGROV1 cells by sulforhodamine B assay
Growth inhibition of human IGROV1 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| KM12 | GI50 |
1.03 μM
Compound: 8
|
Growth inhibition of human KM12 cells by sulforhodamine B assay
Growth inhibition of human KM12 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| KM12 | GI50 |
1.03 x 10-6 M
Compound: 8
|
Growth inhibition of human KM12 cells by sulforhodamine B assay
Growth inhibition of human KM12 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| LOX IMVI | GI50 |
1.01 x 10-5 M
Compound: 8
|
Growth inhibition of human LOXIMVI cells by sulforhodamine B assay
Growth inhibition of human LOXIMVI cells by sulforhodamine B assay
|
[PMID: 19961183] |
| M14 | GI50 |
1.66 x 10-7 M
Compound: 8
|
Growth inhibition of human M14 cells by sulforhodamine B assay
Growth inhibition of human M14 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| M14 | GI50 |
1.66 x 10-1 μM
Compound: 8
|
Growth inhibition of human M14 cells by sulforhodamine B assay
Growth inhibition of human M14 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| Malme-3M | GI50 |
1.22 x 10-5 M
Compound: 8
|
Growth inhibition of human MALME-3M cells by sulforhodamine B assay
Growth inhibition of human MALME-3M cells by sulforhodamine B assay
|
[PMID: 19961183] |
| MCF7 | GI50 |
3.42 μM
Compound: 8
|
Growth inhibition of human MCF7 cells by sulforhodamine B assay
Growth inhibition of human MCF7 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| MCF7 | GI50 |
3.42 x 10-6 M
Compound: 8
|
Growth inhibition of human MCF7 cells by sulforhodamine B assay
Growth inhibition of human MCF7 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| MDA-MB-231 | GI50 |
2.09 x 10-5 M
Compound: 8
|
Growth inhibition of human MDA-MB-231 cells by sulforhodamine B assay
Growth inhibition of human MDA-MB-231 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| MDA-MB-435 | GI50 |
3.99 x 10-7 M
Compound: 8
|
Growth inhibition of human MDA-MB-435 cells by sulforhodamine B assay
Growth inhibition of human MDA-MB-435 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| MDA-MB-435 | GI50 |
3.99 x 10-1 μM
Compound: 8
|
Growth inhibition of human MDA-MB-435 cells by sulforhodamine B assay
Growth inhibition of human MDA-MB-435 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| MDA-MB-468 | GI50 |
7.34 μM
Compound: 8
|
Growth inhibition of human MDA-MB-468 cells by sulforhodamine B assay
Growth inhibition of human MDA-MB-468 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| MDA-MB-468 | GI50 |
7.34 x 10-6 M
Compound: 8
|
Growth inhibition of human MDA-MB-468 cells by sulforhodamine B assay
Growth inhibition of human MDA-MB-468 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| NCI/ADR-RES | GI50 |
8.14 x 10-8 M
Compound: 8
|
Growth inhibition of human NCI/ADR-RES cells by sulforhodamine B assay
Growth inhibition of human NCI/ADR-RES cells by sulforhodamine B assay
|
[PMID: 19961183] |
| NCI/ADR-RES | GI50 |
8.14 x 10-2 μM
Compound: 8
|
Growth inhibition of human NCI/ADR-RES cells by sulforhodamine B assay
Growth inhibition of human NCI/ADR-RES cells by sulforhodamine B assay
|
[PMID: 19961183] |
| NCI-H226 | GI50 |
1.55 x 10-5 M
Compound: 8
|
Growth inhibition of human NCI-H226 cells by sulforhodamine B assay
Growth inhibition of human NCI-H226 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| NCI-H23 | GI50 |
1.51 x 10-5 M
Compound: 8
|
Growth inhibition of human NCI-H23 cells by sulforhodamine B assay
Growth inhibition of human NCI-H23 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| NCI-H322M | GI50 |
2.31 x 10-5 M
Compound: 8
|
Growth inhibition of human NCI-H322M cells by sulforhodamine B assay
Growth inhibition of human NCI-H322M cells by sulforhodamine B assay
|
[PMID: 19961183] |
| NCI-H460 | GI50 |
7.24 x 10-7 M
Compound: 8
|
Growth inhibition of human NCI-H460 cells by sulforhodamine B assay
Growth inhibition of human NCI-H460 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| NCI-H460 | GI50 |
7.24 x 10-1 μM
Compound: 8
|
Growth inhibition of human NCI-H460 cells by sulforhodamine B assay
Growth inhibition of human NCI-H460 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| NCI-H522 | GI50 |
9.14 x 10-8 M
Compound: 8
|
Growth inhibition of human NCI-H522 cells by sulforhodamine B assay
Growth inhibition of human NCI-H522 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| NCI-H522 | GI50 |
9.14 x 10-2 μM
Compound: 8
|
Growth inhibition of human NCI-H522 cells by sulforhodamine B assay
Growth inhibition of human NCI-H522 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| OVCAR-3 | GI50 |
5.19 μM
Compound: 8
|
Growth inhibition of human OVCAR-3 cells by sulforhodamine B assay
Growth inhibition of human OVCAR-3 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| OVCAR-3 | GI50 |
5.19 x 10-6 M
Compound: 8
|
Growth inhibition of human OVCAR-3 cells by sulforhodamine B assay
Growth inhibition of human OVCAR-3 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| OVCAR-4 | GI50 |
3.16 x 10-5 M
Compound: 8
|
Growth inhibition of human OVCAR4 cells by sulforhodamine B assay
Growth inhibition of human OVCAR4 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| OVCAR-5 | GI50 |
2.68 x 10-7 M
Compound: 8
|
Growth inhibition of human OVCAR5 cells by sulforhodamine B assay
Growth inhibition of human OVCAR5 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| OVCAR-5 | GI50 |
2.68 x 10-1 μM
Compound: 8
|
Growth inhibition of human OVCAR5 cells by sulforhodamine B assay
Growth inhibition of human OVCAR5 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| OVCAR-8 | GI50 |
5.74 x 10-8 M
Compound: 8
|
Growth inhibition of human OVCAR8 cells by sulforhodamine B assay
Growth inhibition of human OVCAR8 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| OVCAR-8 | GI50 |
5.74 x 10-2 μM
Compound: 8
|
Growth inhibition of human OVCAR8 cells by sulforhodamine B assay
Growth inhibition of human OVCAR8 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| PC-3 | GI50 |
4.67 x 10-7 M
Compound: 8
|
Growth inhibition of human PC3 cells by sulforhodamine B assay
Growth inhibition of human PC3 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| PC-3 | GI50 |
4.67 x 10-1 μM
Compound: 8
|
Growth inhibition of human PC3 cells by sulforhodamine B assay
Growth inhibition of human PC3 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| RXF 393 | GI50 |
1 x 10-4 M
Compound: 8
|
Growth inhibition of human RXF393 cells by sulforhodamine B assay
Growth inhibition of human RXF393 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| SF-268 | GI50 |
2.47 x 10-5 M
Compound: 8
|
Growth inhibition of human SF268 cells by sulforhodamine B assay
Growth inhibition of human SF268 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| SF-295 | GI50 |
6.55 x 10-7 M
Compound: 8
|
Growth inhibition of human SF295 cells by sulforhodamine B assay
Growth inhibition of human SF295 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| SF-295 | GI50 |
6.55 x 10-1 μM
Compound: 8
|
Growth inhibition of human SF295 cells by sulforhodamine B assay
Growth inhibition of human SF295 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| SF-539 | GI50 |
6.18 x 10-8 M
Compound: 8
|
Growth inhibition of human SF539 cells by sulforhodamine B assay
Growth inhibition of human SF539 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| SF-539 | GI50 |
6.18 x 10-2 μM
Compound: 8
|
Growth inhibition of human SF539 cells by sulforhodamine B assay
Growth inhibition of human SF539 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| SH-SY5Y | IC50 |
3 nM
Compound: 8
|
Cytotoxicity against human SH-SY5Y cells assessed as reduction of total cellular NAD(P) level
Cytotoxicity against human SH-SY5Y cells assessed as reduction of total cellular NAD(P) level
|
[PMID: 19961183] |
| SH-SY5Y | IC50 |
3.8 nM
Compound: 8
|
Cytotoxicity against human SH-SY5Y cells assessed as cell viability after 48 hrs by MTT assay
Cytotoxicity against human SH-SY5Y cells assessed as cell viability after 48 hrs by MTT assay
|
[PMID: 19961183] |
| SH-SY5Y | IC50 |
3.8 nM
Compound: 5
|
Cytotoxicity against human SH-SY5Y cells
Cytotoxicity against human SH-SY5Y cells
|
[PMID: 21080724] |
| SK-MEL-2 | GI50 |
1.28 x 10-5 M
Compound: 8
|
Growth inhibition of human SK-MEL-2 cells by sulforhodamine B assay
Growth inhibition of human SK-MEL-2 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| SK-MEL-28 | GI50 |
1.59 μM
Compound: 8
|
Growth inhibition of human SK-MEL-28 cells by sulforhodamine B assay
Growth inhibition of human SK-MEL-28 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| SK-MEL-28 | GI50 |
1.59 x 10-6 M
Compound: 8
|
Growth inhibition of human SK-MEL-28 cells by sulforhodamine B assay
Growth inhibition of human SK-MEL-28 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| SK-MEL-5 | GI50 |
2.64 x 10-5 M
Compound: 8
|
Growth inhibition of human SK-MEL-5 cells by sulforhodamine B assay
Growth inhibition of human SK-MEL-5 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| SK-OV-3 | GI50 |
2.05 x 10-5 M
Compound: 8
|
Growth inhibition of human SKOV3 cells by sulforhodamine B assay
Growth inhibition of human SKOV3 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| SN12C | GI50 |
4.26 x 10-8 M
Compound: 8
|
Growth inhibition of human SN12C cells by sulforhodamine B assay
Growth inhibition of human SN12C cells by sulforhodamine B assay
|
[PMID: 19961183] |
| SN12C | GI50 |
4.26 x 10-2 μM
Compound: 8
|
Growth inhibition of human SN12C cells by sulforhodamine B assay
Growth inhibition of human SN12C cells by sulforhodamine B assay
|
[PMID: 19961183] |
| SNB-19 | GI50 |
4.5 x 10-7 M
Compound: 8
|
Growth inhibition of human SNB19 cells by sulforhodamine B assay
Growth inhibition of human SNB19 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| SNB-19 | GI50 |
4.5 x 10-1 μM
Compound: 8
|
Growth inhibition of human SNB19 cells by sulforhodamine B assay
Growth inhibition of human SNB19 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| SNB-75 | GI50 |
2.98 x 10-5 M
Compound: 8
|
Growth inhibition of human SNB75 cells by sulforhodamine B assay
Growth inhibition of human SNB75 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| SW-620 | GI50 |
6.15 x 10-8 M
Compound: 8
|
Growth inhibition of human SW620 cells by sulforhodamine B assay
Growth inhibition of human SW620 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| SW-620 | GI50 |
6.15 x 10-2 μM
Compound: 8
|
Growth inhibition of human SW620 cells by sulforhodamine B assay
Growth inhibition of human SW620 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| T47D | GI50 |
1.23 μM
Compound: 8
|
Growth inhibition of human T47D cells by sulforhodamine B assay
Growth inhibition of human T47D cells by sulforhodamine B assay
|
[PMID: 19961183] |
| T47D | GI50 |
1.23 x 10-6 M
Compound: 8
|
Growth inhibition of human T47D cells by sulforhodamine B assay
Growth inhibition of human T47D cells by sulforhodamine B assay
|
[PMID: 19961183] |
| TK-10 | GI50 |
1.82 x 10-5 M
Compound: 8
|
Growth inhibition of human TK10 cells by sulforhodamine B assay
Growth inhibition of human TK10 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| U-251 | GI50 |
5.21 x 10-7 M
Compound: 8
|
Growth inhibition of human U251 cells by sulforhodamine B assay
Growth inhibition of human U251 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| U-251 | GI50 |
5.21 x 10-1 μM
Compound: 8
|
Growth inhibition of human U251 cells by sulforhodamine B assay
Growth inhibition of human U251 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| UACC-257 | GI50 |
1.33 x 10-5 M
Compound: 8
|
Growth inhibition of human UACC257 cells by sulforhodamine B assay
Growth inhibition of human UACC257 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| UACC-62 | GI50 |
1.33 x 10-5 M
Compound: 8
|
Growth inhibition of human UACC62 cells by sulforhodamine B assay
Growth inhibition of human UACC62 cells by sulforhodamine B assay
|
[PMID: 19961183] |
| UO-31 | GI50 |
1.69 x 10-5 M
Compound: 8
|
Growth inhibition of human UO31 cells by sulforhodamine B assay
Growth inhibition of human UO31 cells by sulforhodamine B assay
|
[PMID: 19961183] |
In Vitro
GPP78 (Compound 8; 10 nM; 24-40 hours; SH-SY5Y cells) treatment with cells, punctate staining of LC3-II and the formation of autophagolysosomes are observable. LC3-II is membrane-bound and is present in autophagosomes[1].
GPP78 (Compound 8) inhibits the growth of most cell lines tested, with nanomolar potency (GI50) in cell lines derived from leukemia, lung, CNS, colon, melanoma, ovarian, renal, and prostate cancers. GPP78 appears truly cytotoxic in melanoma cell lines, while in the others it is mainly cytostatic[1].
MedChemExpress (MCE) has not independently confirmed the accuracy of these methods. They are for reference only.
-
Cell Line:SH-SY5Y cells
-
Concentration:10 nM
-
Incubation Time:24 hours, 40 hours
-
Result:Punctate staining of LC3-II and the formation of autophagolysosomes were observable.
In Vivo
MedChemExpress (MCE) has not independently confirmed the accuracy of these methods. They are for reference only.
-
Animal Model:Male adult CD1 mice (25-30 g) with spinal cord injury (SCI)[2]
-
Dosage:10 mg/kg
-
Administration:Intraperitoneal injection; daily; 1 hour or 6 hours after SCI; for 19 days
-
Result:Significantly reduced the demyelination associated with SCI. And significantly ameliorated the functional deficits induced by SCI.
Chemical Information
-
CAS No. 1202580-59-3
-
Appearance Liquid
-
Molecular Weight 439.55
-
Formula C27H29N5O
-
Color Colorless to light yellow
-
SMILES
O=C(CCCCCCCN1N=NC(C2=CN=CC=C2)=C1)NC3=CC=CC=C3C4=CC=CC=C4
-
Synonyms
CAY10618
-
Shipping
Room temperature in continental US; may vary elsewhere.
-
Storage
Solution, -20°C, 2 years
Publications (1)
-
Journal Impact Factor
-
Most Recent
-
Sci Signal
Metabolic perturbations sensitize triple-negative breast cancers to apoptosis induced by BH3 mimetics. [Abstract]2021 Jun 8;14(686):eabc7405. PMID: 34103421
Purity & Documentation
-
Data Sheet (271 KB)
-
SDS (419 KB)
- English - EN (419 KB)
- Français - FR (419 KB)
- Deutsch - DE (419 KB)
- Norwegian - NO (419 KB)
- Español - ES (419 KB)
- Swedish - SV (419 KB)
- Italian - IT (419 KB)
- Korean - KR (419 KB)
- Portuguese - PT (419 KB)
-
Handling Instructions (2659 KB)
References
[1]. Colombano G, et al. A novel potent nicotinamide phosphoribosyltransferase inhibitor synthesized via click chemistry. J Med Chem. 2010 Jan 28;53(2):616-23. [Content Brief]
[2]. Esposito E, et al. The NAMPT inhibitor FK866 reverts the damage in spinal cord injury. J Neuroinflammation. 2012 Apr 10;9:66. [Content Brief]
Calculators
Concentration (start) × Volume (start) = Concentration (final) × Volume (final)