103213-34-9
Chemical Structure
Gly-Pro-pNA hydrochloride
- CAS. Nr.: 103213-34-9
- Formula:C13H17ClN4O4
- Molecular Weight:328.76
IUPAC Name: (S)-1-glycyl-N-(4-nitrophenyl)pyrrolidine-2-carboxamide hydrochloride
InChIKey: VBBFIBMVFSUUBP-MERQFXBCSA-N
SMILES: O=C(N1CCC[C@H]1C(NC2=CC=C(C=C2)[N+]([O-])=O)=O)CN.Cl
Biological Activity: Gly-Pro-pNA hydrochloride is a chromogenic peptide substrate that can be cleaved by the circulating enzyme dipeptidyl peptidase IV (DPP IV). Gly-Pro-pNA hydrochloride is mainly used to detect the activity of aminopeptidases such as DPP IV. Gly-Pro-pNA hydrochloride can be investigated as an experimental antidiabetic agent[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Gly-Pro-pNA hydrochloride | 99.92% | Gly-Pro-pNA hydrochloride is a chromogenic peptide substrate that can be cleaved by the circulating enzyme dipeptidyl peptidase IV (DPP IV). Gly-Pro-pNA hydrochloride is mainly used to detect the activity of aminopeptidases such as DPP IV. Gly-Pro-pNA hydrochloride can be investigated as an experimental antidiabetic agent. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords