121-92-6
Chemical Structure
3-Nitrobenzoic acid
Synonym(s): m-Carboxynitrobenzene; m-Nitrobenzenecarboxylic acid; m-Nitrobenzoic acid
- CAS No.: 121-92-6
- Formula:C7H5NO4
- Molecular Weight:167.12
IUPAC Name: 3-nitrobenzoic acid
InChIKey: AFPHTEQTJZKQAQ-UHFFFAOYSA-N
SMILES: O=C(O)C1=CC=CC([N+]([O-])=O)=C1
Biological Activity: 3-Nitrobenzoic acid (m-Carboxynitrobenzene; m-Nitrobenzenecarboxylic acid; m-Nitrobenzoic acid) is an antioxidant and antibacterial agent that can kill bacteria and fungi. 3-Nitrobenzoic acid can be degraded or reduced by certain bacteria (such as Pseudomonas) and fungi (such as white rot fungi) into aldehydes and alcohols[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
3-Nitrobenzoic acid | 99.91% | 3-Nitrobenzoic acid (m-Carboxynitrobenzene; m-Nitrobenzenecarboxylic acid; m-Nitrobenzoic acid) is an antioxidant and antibacterial agent that can kill bacteria and fungi. 3-Nitrobenzoic acid can be degraded or reduced by certain bacteria (such as Pseudomonas) and fungi (such as white rot fungi) into aldehydes and alcohols. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Rosenthal SM, Bauer H. Trypanocidal action of 3-nitrobenzoic acid and some derivatives. Proceedings of the Society for Experimental Biology and Medicine. 1941 Jun;47(2):335-7.
- [2]. Hage A, Schoemaker HE, Field JA. Reduction of aryl acids by white-rot fungi for the biocatalytic production of aryl aldehydes and alcohols. Appl Microbiol Biotechnol. 1999 Nov;52(6):834-8. [Content Brief]
Keywords
