1348418-97-2
Chemical Structure
Scrambled TRAP Fragment
- CAS. Nr.: 1348418-97-2
- Formula:C34H57N11O8
- Molecular Weight:747.89
InChIKey: WEPBSJWHRWHFRN-FRSCJGFNSA-N
SMILES: O=C(N[C@@H](CO)C(N[C@@H](CC(C)C)C(N[C@@H](CC(C)C)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CC(N)=O)C(N)=O)=O)=O)=O)=O)[C@H](CC1=CC=CC=C1)N
Biological Activity: Scrambled TRAP Fragment is a scrambled sequence of TRAP Fragment. Scrambled TRAP Fragment with a random sequence of the amino acids that are the same as the active fragment. Scrambled TRAP Fragment usually used as a negative control.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Scrambled TRAP Fragment | Scrambled TRAP Fragment is a scrambled sequence of TRAP Fragment. Scrambled TRAP Fragment with a random sequence of the amino acids that are the same as the active fragment. Scrambled TRAP Fragment usually used as a negative control. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords