140652-99-9
Chemical Structure
JCP-265
- CAS No.: 140652-99-9
- Formula:C21H18BrClN2O6
- Molecular Weight:509.73
IUPAC Name: (S)-1-((3-(2-bromoethoxy)-4-chloro-1-oxo-1H-isochromen-7-yl)amino)-1-oxopropan-2-yl phenylcarbamate
InChIKey: VOIQWVHTMKOBBL-LBPRGKRZSA-N
SMILES: C[C@@H](C(NC1=CC=C(C(Cl)=C(OC2=O)OCCBr)C2=C1)=O)OC(NC3=CC=CC=C3)=O
Biological Activity: JCP-265 is a compound used for in vivo phenotypic screening of small molecule libraries, which has the activity of screening molecules that regulate cell function. JCP-265 uses molecular cell barcoding technology to directly screen small molecule libraries in vivo for studying complex physiological processes, such as screening compounds related to targets in pancreatic cancer metastasis seeding studies.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
JCP-265 | JCP-265 is a compound used for in vivo phenotypic screening of small molecule libraries, which has the activity of screening molecules that regulate cell function. JCP-265 uses molecular cell barcoding technology to directly screen small molecule libraries in vivo for studying complex physiological processes, such as screening compounds related to targets in pancreatic cancer metastasis seeding studies. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||