1446352-30-2
Chemical Structure
BRD-9526
- CAS No.: 1446352-30-2
- Formula:C26H31Cl2N3O6S
- Molecular Weight:584.51
IUPAC Name: N-((2R,3S)-2-(((2,4-dichloro-N-methylphenyl)sulfonamido)methyl)-5-((R)-1-hydroxypropan-2-yl)-3-methyl-6-oxo-3,4,5,6-tetrahydro-2H-benzo[b][1,5]oxazocin-10-yl)cyclopropanecarboxamide
InChIKey: YBAHAAHRDXLORA-DMPWYTOCSA-N
SMILES: O=C(C1CC1)NC2=C3C(C(N(C[C@@H]([C@@H](O3)CN(C)S(=O)(C4=C(C=C(C=C4)Cl)Cl)=O)C)[C@H](C)CO)=O)=CC=C2
Biological Activity: BRD-9526 is a potent and selective Sonic Hedgehog (Shh) pathway inhibitor with potential anti-cancer activity. The mechanism of BRD-9526 is similar in some ways to commonly used inhibitors such as cyclopamine, but is significantly different in other ways. The discovery of BRD-9526 may provide a useful probe for studying complex signaling pathways[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
BRD-9526 | BRD-9526 is a potent and selective Sonic Hedgehog (Shh) pathway inhibitor with potential anti-cancer activity. The mechanism of BRD-9526 is similar in some ways to commonly used inhibitors such as cyclopamine, but is significantly different in other ways. The discovery of BRD-9526 may provide a useful probe for studying complex signaling pathways. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
