14875-96-8
Chemical Structure
Ferroheme
- CAS No.: 14875-96-8
- Formula:C34H32FeN4O4
- Molecular Weight:616.49
InChIKey: KABFMIBPWCXCRK-RGGAHWMASA-L
SMILES: [O-]C(CCC(C1=CC(C(CCC([O-])=O)=C2C)=[N](C2=C3)[Fe+2]4([N-]5C3=C6C)[N-]1C7=CC(C(C=C)=C8C)=[N]4C8=CC5=C6C=C)=C7C)=O.[H+].[H+]
Biological Activity: Ferroheme is the ferrous form of heme in hemoglobin, reversibly binding oxygen as an oxygen carrier. Its free form induces oxidative stress and ferroptosis by releasing iron ions, which catalyze reactive oxygen species generation via Fenton reactions, leading to lipid peroxidation and cell death. This mechanism is critical in pathological contexts like intracerebral hemorrhage and neurodegenerative diseases, making it a target for studying iron-overload disorders and ferroptosis-related pathologies[1][2][3].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ferroheme | 99.70% | Ferroheme is the ferrous form of heme in hemoglobin, reversibly binding oxygen as an oxygen carrier. Its free form induces oxidative stress and ferroptosis by releasing iron ions, which catalyze reactive oxygen species generation via Fenton reactions, leading to lipid peroxidation and cell death. This mechanism is critical in pathological contexts like intracerebral hemorrhage and neurodegenerative diseases, making it a target for studying iron-overload disorders and ferroptosis-related pathologies. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords