1623-93-4
Chemical Structure
4-Biphenylsulfonyl chloride
- CAS No.: 1623-93-4
- Formula:C12H9ClO2S
- Molecular Weight:252.72
IUPAC Name: [1,1'-biphenyl]-4-sulfonyl chloride
InChIKey: ALBQXDHCMLLQMB-UHFFFAOYSA-N
SMILES: ClS(C1=CC=C(C2=CC=CC=C2)C=C1)(=O)=O
Biological Activity: 4-Biphenylsulfonyl chloride is a synthetic intermediate that participates in the sulfonamide formation reaction to synthesize antiproliferative compounds. The derivatives of 4-Biphenylsulfonyl chloride inhibit human head and neck squamous cell carcinoma (HNSCC) cells by increasing PTEN expression and inhibiting the PI3K/Akt/mTOR pathway. 4-Biphenylsulfonyl chloride can be used in the development of anticancer drugs for HNSCC[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
4-Biphenylsulfonyl chloride | 99.59% | 4-Biphenylsulfonyl chloride is a synthetic intermediate that participates in the sulfonamide formation reaction to synthesize antiproliferative compounds. The derivatives of 4-Biphenylsulfonyl chloride inhibit human head and neck squamous cell carcinoma (HNSCC) cells by increasing PTEN expression and inhibiting the PI3K/Akt/mTOR pathway. 4-Biphenylsulfonyl chloride can be used in the development of anticancer drugs for HNSCC. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||