171047-47-5
Chemical Structure
Ladirubicin
Synonym(s): PNU-159548
- CAS No.: 171047-47-5
- Formula:C29H31NO11S
- Molecular Weight:601.62
IUPAC Name: (2S,3S,4S,6R)-6-(((1S,3S)-3-acetyl-3,5,12-trihydroxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl)oxy)-4-(aziridin-1-yl)-2-methyltetrahydro-2H-pyran-3-yl methanesulfonate
InChIKey: VMDWTZZCNDEKIO-CBNJBKGYSA-N
SMILES: C[C@H]1[C@@H](OS(C)(=O)=O)[C@@H](N2CC2)C[C@](O1)([H])O[C@@H]3C4=C(O)C(C(C5=CC=CC=C5C6=O)=O)=C6C(O)=C4C[C@](C(C)=O)(O)C3
Biological Activity: Ladirubicin (PNU-159548) is a derivative of Daunorubicin (HY-13062A). Ladirubicin exhibits DNA intercalation and DNA alkylating properties, inhibits DNA replication and transcription, causes DNA damage, and thereby exhibits antitumor efficacy. Ladirubicin exhibits the potential to penetrate the blood-brain barrier (BBB) for its high lipophilicity. Ladirubicin exhibits toxicity through suppression of bone marrow activity[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ladirubicin | Ladirubicin (PNU-159548) is a derivative of Daunorubicin (HY-13062A). Ladirubicin exhibits DNA intercalation and DNA alkylating properties, inhibits DNA replication and transcription, causes DNA damage, and thereby exhibits antitumor efficacy. Ladirubicin exhibits the potential to penetrate the blood-brain barrier (BBB) for its high lipophilicity. Ladirubicin exhibits toxicity through suppression of bone marrow activity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
