221905-51-7
Chemical Structure
8-NBD-cAMP sodium
- CAS No.: 221905-51-7
- Formula:C18H17N9NaO9PS
- Molecular Weight:589.41
IUPAC Name: sodium (4aR,6R,7R,7aS)-6-(6-amino-8-((2-((7-nitrobenzo[c][1,2,5]oxadiazol-4-yl)amino)ethyl)thio)-9H-purin-9-yl)-7-hydroxytetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-olate 2-oxide
InChIKey: KQPZJPTUFDWJIG-GBIKJYCISA-M
SMILES: NC1=C(N=C2SCCNC3=CC=C([N+]([O-])=O)C4=NON=C43)C(N2[C@@]5([H])[C@H](O)[C@@](OP(OC6)(O[Na])=O)([H])[C@]6([H])O5)=NC=N1
Biological Activity: 8-NBD-cAMP sodium is a fluorescently labeled cyclic adenosine phosphate (cAMP) analogue. 8-NBD-cAMP sodium retains a similar biological activity to cAMP, regulating their activity by binding to specific proteins such as EPACs or PKA. 8-NBD-cAMP sodium can be used in fluorescent competitive binding experiments to evaluate the binding affinity of newly synthesized EPAC1 agonists to EPAC1 proteins[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
8-NBD-cAMP sodium | 8-NBD-cAMP sodium is a fluorescently labeled cyclic adenosine phosphate (cAMP) analogue. 8-NBD-cAMP sodium retains a similar biological activity to cAMP, regulating their activity by binding to specific proteins such as EPACs or PKA. 8-NBD-cAMP sodium can be used in fluorescent competitive binding experiments to evaluate the binding affinity of newly synthesized EPAC1 agonists to EPAC1 proteins. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||