2329719-65-3
Chemical Structure
BRD-810
- CAS No.: 2329719-65-3
- Formula:C39H44ClFN4O5
- Molecular Weight:703.24
InChIKey: RQXSLNDYCDRXAC-MGBGTMOVSA-N
SMILES: O=C(O)C(N1CCCCO[C@H](CCN2CCOCC2)C3=NN(C)C(CC)=C43)=C(CCCOC5=C6C(C=C(F)C=C6)=CC=C5)C7=C1C4=C(Cl)C=C7
Biological Activity: BRD-810 is a potent and selective MCL1 inhibitor with a Kd of 0.3 nM. BRD-810 can specifically block the BH3 binding groove of MCL1, while having little effect on other anti-apoptotic proteins (such as Bcl-2, Bcl-xL). BRD-810 effectively destroys the MCL1-BAK complex (IC50 = 1.2 nM) in cancer cells, rapidly activates Caspase and induces cell apoptosis. BRD-810 can be used in the research of various cancers such as hematological tumors and solid tumors[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
BRD-810 | 98.21% | BRD-810 is a potent and selective MCL1 inhibitor with a Kd of 0.3 nM. BRD-810 can specifically block the BH3 binding groove of MCL1, while having little effect on other anti-apoptotic proteins (such as Bcl-2, Bcl-xL). BRD-810 effectively destroys the MCL1-BAK complex (IC50 = 1.2 nM) in cancer cells, rapidly activates Caspase and induces cell apoptosis. BRD-810 can be used in the research of various cancers such as hematological tumors and solid tumors. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords