2364591-80-8
2364591-80-8
Chemical Structure
5-endo-BCN-pentanoic acid
- CAS No.: 2364591-80-8
- Formula:C16H23NO4
- Molecular Weight:293.36
IUPAC Name: 5-(((bicyclo[6.1.0]non-4-yn-9-ylmethoxy)carbonyl)amino)pentanoic acid
InChIKey: SHBBGNJSLQPJLH-UHFFFAOYSA-N
SMILES: O=C(O)CCCCNC(OCC1C2CCC#CCCC12)=O
Biological Activity: 5-endo-BCN-pentanoic acid is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. 5-endo-BCN-pentanoic acid is a click chemistry reagent, it contains a BCN group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
5-endo-BCN-pentanoic acid | 95.0% | 5-endo-BCN-pentanoic acid is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs. 5-endo-BCN-pentanoic acid is a click chemistry reagent, it contains a BCN group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
endo-BCN-PEG2-acid | endo-BCN-PEG2-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. endo-BCN-PEG2-acid is a click chemistry reagent, it contains a BCN group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
BCN-PEG3-OH | 95.0% | BCN-PEG3-OH is a non-cleavable 4 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). BCN-PEG3-OH is a click chemistry reagent, it contains a BCN group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
endo-BCN-PEG3-acid | 98.60% | endo-BCN-PEG3-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
endo-BCN-PEG4-acid | 95.0% | endo-BCN-PEG4-acid is a cleavable 4 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). endo-BCN-PEG4-acid is a click chemistry reagent, it contains a BCN group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
endo-BCN-PEG2-alcohol | 98.0% | endo-BCN-PEG2-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. endo-BCN-PEG2-alcohol is a click chemistry reagent, it contains a BCN group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
BCN-exo-PEG2-NH2 | BCN-exo-PEG2-NH2 is an ADC Linker containing 2 PEG units. BCN-exo-PEG2-NH2 contains the lyophilic bidentate macrocyclic ligand BCN, which can further synthesize macrocyclic complexes. In click chemistry, BCN reacts with molecules containing azide groups to form stable triazoles in the absence of catalysts. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
endo-BCN-L-Lysine | 95.0% | Endo-BCN-L-Lysine is a Click Amino Acid that can be used as a linker in the synthesis of PROTAC molecules. Endo-BCN-L-Lysine contains a BCN group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
(Rac)-BCN-L-Lysine | (Rac)-BCN-L-Lysine is a Click Amino Acid that can be used as a linker in the synthesis of PROTAC molecules. (Rac)-BCN-L-Lysine contains a BCN group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
endo-BCN-PEG2-NH2 | 95.54% | endo-BCN-PEG2-NH2 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. endo-BCN-PEG2-NH2 contains a BCN group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
exo-BCN-L-Lysine | 95.0% | exo-BCN-L-Lysine is a noncanonical amino acid containing a BCN group. exo-BCN-L-Lysine is biosynthesized into peptides, generating BCN-peptides. exo-BCN-L-Lysine enables copper-free click reaction with tetrazine-modified molecules, and this click chemistry is compatible with ribosome display. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
