261929-60-6
Chemical Structure
SDH-IN-36
- CAS No.: 261929-60-6
- Formula:C31H53NO3
- Molecular Weight:487.76
InChIKey: XEGUKHSTHKNIES-CEFNRUSXSA-N
SMILES: CC1=C2CC[C@](OC2=C(C(C)=C1OCC(N)=O)C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C
Biological Activity: SDH-IN-36 (Compound 17) is a derivative of alpha-D-tocopherol. SDH-IN-36 increases ROS and induces apoptosis by inhibiting SDHC and blocking electron transfer. SDH-IN-36 can inhibit the proliferation of various tumor cells, such as SSK4 (GI50 = 0.156 µM), SSNU638 (GI50 = 0.659 µM), and SKATOIII (GI50 = 0.490 µM) cells. SDH-IN-36 can significantly inhibit tumor growth. SDH-IN-36 can be used for research on cancers such as gastric cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
SDH-IN-36 | SDH-IN-36 (Compound 17) is a derivative of alpha-D-tocopherol. SDH-IN-36 increases ROS and induces apoptosis by inhibiting SDHC and blocking electron transfer. SDH-IN-36 can inhibit the proliferation of various tumor cells, such as SSK4 (GI50 = 0.156 µM), SSNU638 (GI50 = 0.659 µM), and SKATOIII (GI50 = 0.490 µM) cells. SDH-IN-36 can significantly inhibit tumor growth. SDH-IN-36 can be used for research on cancers such as gastric cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||