3101563-22-5
Chemical Structure
AZ14289671
- CAS. Nr.: 3101563-22-5
- Formula:C23H14Cl2F2N6O
- Molecular Weight:499.30
InChIKey: QQHSTNZKSXNHSM-UHFFFAOYSA-N
SMILES: O=C(N1CC2=C(C1)N(C3=CC=NC=N3)C(C4=C(F)C=C(F)C(C5=C(Cl)N=CC(Cl)=C5)=C4)=N2)C=C
Biological Activity: AZ14289671 is an orally active, blood-brain barrier-penetrant tyrosine kinase (tyrosine kinase) inhibitor (TKI) that specifically targets non-small cell lung cancer (NSCLC) harboring EGFR exon 20 insertion mutations (EGFRExon20Ins), while largely sparing wild-type EGFR to reduce off-target toxicities such as rash and diarrhea. AZ14289671 inhibits the downstream MAPK/ERK/AKT pathway, suppressing tumor cell proliferation, survival and migration. AZ14289671 can be used for NSCLC research[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
AZ14289671 | 98.99% | AZ14289671 is an orally active, blood-brain barrier-penetrant tyrosine kinase (tyrosine kinase) inhibitor (TKI) that specifically targets non-small cell lung cancer (NSCLC) harboring EGFR exon 20 insertion mutations (EGFRExon20Ins), while largely sparing wild-type EGFR to reduce off-target toxicities such as rash and diarrhea. AZ14289671 inhibits the downstream MAPK/ERK/AKT pathway, suppressing tumor cell proliferation, survival and migration. AZ14289671 can be used for NSCLC research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords