33400-89-4
Chemical Structure
Coriolin B
- CAS No.: 33400-89-4
- Formula:C23H36O6
- Molecular Weight:408.53
InChIKey: OMZMPIPAPFDGKE-MYRBWEMOSA-N
SMILES: C[C@]12[C@@]3([C@@H]([C@]4([H])[C@@]2([H])[C@H](C(C)(C4)C)OC(CCCCCCC)=O)O)[C@]([C@@H]([C@@]15CO5)O)([H])O3
Biological Activity: Coriolin B has anti-Gram-positive bacteria, negative bacteria (weak), yeast and vaginal trichomoniasis activities. Coriolin B of 5 μg/mL can inhibit the growth of yoshida sarcoma 61.6%. Coriolin B has no inhibitory effect on Ehrlich ascites carcinoma in animals[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Coriolin B | Coriolin B has anti-Gram-positive bacteria, negative bacteria (weak), yeast and vaginal trichomoniasis activities. Coriolin B of 5 μg/mL can inhibit the growth of yoshida sarcoma 61.6%. Coriolin B has no inhibitory effect on Ehrlich ascites carcinoma in animals. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords