35807-85-3
Chemical Structure
Tauroursodeoxycholate sodium
Synonym(s): Tauroursodeoxycholic acid sodium; TUDCA sodium; UR 906 sodium
- CAS No.: 35807-85-3
- Formula:C26H44NNaO6S
- Molecular Weight:521.69
IUPAC Name: sodium 2-((R)-4-((3R,5S,7S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanamido)ethane-1-sulfonate
InChIKey: IYPNVUSIMGAJFC-JUWYWQLMSA-M
SMILES: C[C@H](CCC(NCCS(=O)(O[Na])=O)=O)[C@H]1CC[C@@]2([H])[C@]3([H])[C@@H](O)C[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C
Biological Activity: Tauroursodeoxycholate (Tauroursodeoxycholic acid; TUDCA) sodium is an endoplasmic reticulum (ER) stress inhibitor. Tauroursodeoxycholate significantly reduces expression of apoptosis molecules, such as caspase-3 and caspase-12. Tauroursodeoxycholate also inhibits ERK.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Tauroursodeoxycholate sodium | 98.40% | Tauroursodeoxycholate (Tauroursodeoxycholic acid; TUDCA) sodium is an endoplasmic reticulum (ER) stress inhibitor. Tauroursodeoxycholate significantly reduces expression of apoptosis molecules, such as caspase-3 and caspase-12. Tauroursodeoxycholate also inhibits ERK. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tauroursodeoxycholate sodium (Standard) | 97.91% | Tauroursodeoxycholate (sodium) (Standard) is the analytical standard of Tauroursodeoxycholate (sodium). This product is intended for research and analytical applications. Tauroursodeoxycholate (Tauroursodeoxycholic acid; TUDCA) sodium is an endoplasmic reticulum (ER) stress inhibitor. Tauroursodeoxycholate significantly reduces expression of apoptosis molecules, such as caspase-3 and caspase-12. Tauroursodeoxycholate also inhibits ERK. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tauroursodeoxycholate-d4 sodium | 99.34% | Tauroursodeoxycholate-d4 (sodium) is the deuterium labeled Tauroursodeoxycholate sodium. Tauroursodeoxycholate (Tauroursodeoxycholic acid; TUDCA) sodium is an endoplasmic reticulum (ER) stress inhibitor. Tauroursodeoxycholate significantly reduces expression of apoptosis molecules, such as caspase-3 and caspase-12. Tauroursodeoxycholate also inhibits ERK. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||