6505-45-9
6505-45-9
Chemical Structure
3-Indoleacetic acid sodium
Synonym(s): Indole-3-acetic acid sodium; 3-IAA sodium
- CAS No.: 6505-45-9
- Formula:C10H8NNaO2
- Molecular Weight:197.17
IUPAC Name: sodium 2-(1H-indol-3-yl)acetate
InChIKey: YGSPWCVTJRFZEL-UHFFFAOYSA-M
SMILES: O=C([O-])CC1=CNC2=C1C=CC=C2.[Na+]
Biological Activity: 3-Indoleacetic acid (Indole-3-acetic acid) sodium is an IAA hormone and growth regulator that can promote plant nutritional growth through processes such as cell expansion, differentiation, morphogenesis, and organogenesis[2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
3-Indoleacetic acid sodium | 99.95% | 3-Indoleacetic acid (Indole-3-acetic acid) sodium is an IAA hormone and growth regulator that can promote plant nutritional growth through processes such as cell expansion, differentiation, morphogenesis, and organogenesis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3-Indoleacetic acid sodium (Standard) | 99.92% | Ginsenoside F1 (Standard) is the analytical standard of Ginsenoside F1. This product is intended for research and analytical applications. Ginsenoside F1, an enzymatically modified derivative of Ginsenoside Rg1, demonstrates competitive inhibition of CYP3A4 activity and weaker inhibition of CYP2D6 activity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
