653-63-4
Chemical Structure
2'-Deoxyadenosine-5'-monophosphate
- CAS No.: 653-63-4
- Formula:C10H14N5O6P
- Molecular Weight:331.23
IUPAC Name: ((2R,3S,5R)-5-(6-amino-9H-purin-9-yl)-3-hydroxytetrahydrofuran-2-yl)methyl dihydrogen phosphate
InChIKey: KHWCHTKSEGGWEX-RRKCRQDMSA-N
SMILES: NC1=C2C(N([C@H]3C[C@H](O)[C@@H](COP(O)(O)=O)O3)C=N2)=NC=N1
Biological Activity: 2′-Deoxyadenosine 5′-monophosphate, a nucleic acid AMP derivative, is a deoxyribonucleotide found in DNA. 2′-Deoxyadenosine 5′-monophosphate can be used to study adenosine-based interactions during DNA synthesis and DNA damage[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
2'-Deoxyadenosine-5'-monophosphate | 99.60% | 2′-Deoxyadenosine 5′-monophosphate, a nucleic acid AMP derivative, is a deoxyribonucleotide found in DNA. 2′-Deoxyadenosine 5′-monophosphate can be used to study adenosine-based interactions during DNA synthesis and DNA damage. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
2'-Deoxyadenosine-5'-monophosphate (Standard) | 99.15% | 2'-Deoxyadenosine-5'-monophosphate (Standard) is the analytical standard of 2'-Deoxyadenosine-5'-monophosphate. This product is intended for research and analytical applications. 2′-Deoxyadenosine 5′-monophosphate, a nucleic acid AMP derivative, is a deoxyribonucleotide found in DNA. 2′-Deoxyadenosine 5′-monophosphate can be used to study adenosine-based interactions during DNA synthesis and DNA damage. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||