67494-15-9
Chemical Structure
Pisiferic acid
- CAS No.: 67494-15-9
- Formula:C20H28O3
- Molecular Weight:316.43
IUPAC Name: (4aR,10aS)-6-hydroxy-7-isopropyl-1,1-dimethyl-1,3,4,9,10,10a-hexahydrophenanthrene-4a(2H)-carboxylic acid
InChIKey: ATHWSPHADLLZSS-PXNSSMCTSA-N
SMILES: O=C([C@]12CCCC(C)(C)[C@]1([H])CCC3=C2C=C(O)C(C(C)C)=C3)O
Biological Activity: Pisiferic acid is an antibacterial agent with inhibitory activity against Gram-negative/positive bacteria such as P. vulgaris, S. aureus and B. subtilis. Pisiferic acid can be used to study bacterial infections[1].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Pisiferic acid | 99.44% | Pisiferic acid is an antibacterial agent with inhibitory activity against Gram-negative/positive bacteria such as P. vulgaris, S. aureus and B. subtilis. Pisiferic acid can be used to study bacterial infections. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||