76938-46-0
Chemical Structure
Viscosalactone B
- CAS No.: 76938-46-0
- Formula:C28H40O7
- Molecular Weight:488.61
IUPAC Name: (E)-3-(3-hydroxy-4-methoxyphenyl)-N-(4-hydroxyphenethyl)acrylamide
InChIKey: WVMINIQLCDVTLH-IVFYTCICSA-N
SMILES: C[C@]12[C@@]3([C@H]([C@H](CC2=O)O)O)[C@](C[C@]4([H])[C@]1([H])CC[C@]5([C@@]4([H])CC[C@]5([H])[C@@H]([C@@]6([H])CC(C)=C(C(O6)=O)CO)C)C)([H])O3
Biological Activity: Viscosalactone B is a withanolide found in Withania somnifera. Viscosalactone B shows potent inhibitory activities to NCI-H460, HCT-116, MCF-7 and SF-268 cancer cells with IC50 values of 0.32, 0.47, 0.4 and 0.45 μg/mL. Viscosalactone B can be used for the research of cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Viscosalactone B | Viscosalactone B is a withanolide found in Withania somnifera. Viscosalactone B shows potent inhibitory activities to NCI-H460, HCT-116, MCF-7 and SF-268 cancer cells with IC50 values of 0.32, 0.47, 0.4 and 0.45 μg/mL. Viscosalactone B can be used for the research of cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||