80508-81-2
Chemical Structure
Glaucocalyxin B
- CAS. Nr.: 80508-81-2
- Formula:C22H30O5
- Molecular Weight:374.47
IUPAC Name: (4aS,6R,6aR,9S,11aS,11bR,12R)-6-hydroxy-4,4,11b-trimethyl-8-methylene-3,7-dioxotetradecahydro-6a,9-methanocyclohepta[a]naphthalen-12-yl acetate
InChIKey: LSUXOKVMORWDLT-KEXKRWMXSA-N
SMILES: CC1(C)C(CC[C@@]2(C)[C@@]3([H])[C@@]4(C(C([C@H](CC3)[C@H]4OC(C)=O)=C)=O)[C@H](O)C[C@]12[H])=O
Biological Activity: Glaucocalyxin B is an ent kaurane diterpenoid isolated from the Chinese traditional medicine Rabdosia japonica with anticancer and antitumor activity; decreases the growth of HL-60 cells with an IC50 of approximately 5.86 μM at 24 h.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Glaucocalyxin B | 99.83% | Glaucocalyxin B is an ent kaurane diterpenoid isolated from the Chinese traditional medicine Rabdosia japonica with anticancer and antitumor activity; decreases the growth of HL-60 cells with an IC50 of approximately 5.86 μM at 24 h. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||