809237-87-4
Chemical Structure
Gnetumontanin B
- CAS No.: 809237-87-4
- Formula:C42H32O11
- Molecular Weight:712.70
IUPAC Name: 5,5'-((2R,2'R,3R,3'R)-2'-(2,4-dihydroxyphenyl)-4,4'-dihydroxy-6-((E)-4-hydroxystyryl)-2,2',3,3'-tetrahydro-[2,7'-bibenzofuran]-3,3'-diyl)bis(benzene-1,3-diol)
InChIKey: RSCPVPKROFWCSQ-NGDBKFESSA-N
SMILES: OC1=CC=C(/C=C/C2=CC3=C([C@H]([C@H](C4=C(O[C@@H](C5=C(O)C=C(O)C=C5)[C@@H]6C7=CC(O)=CC(O)=C7)C6=C(O)C=C4)O3)C8=CC(O)=CC(O)=C8)C(O)=C2)C=C1
Biological Activity: Gnetumontanin B is a stilbenoid that can be found in Gnetum montanum f. megalocarpum. Gnetumontanin B inhibits TNF-α production with an IC50 value of 1.49 µM[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Gnetumontanin B | Gnetumontanin B is a stilbenoid that can be found in Gnetum montanum f. megalocarpum. Gnetumontanin B inhibits TNF-α production with an IC50 value of 1.49 µM. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||