877239-08-2
Chemical Structure
Trityl-PEG10-azide
- CAS No.: 877239-08-2
- Formula:C39H55N3O10
- Molecular Weight:725.87
IUPAC Name: 31-azido-1,1,1-triphenyl-2,5,8,11,14,17,20,23,26,29-decaoxahentriacontane
InChIKey: YGESYAKTEQEZFB-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3
Biological Activity: Trityl-PEG10-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Trityl-PEG10-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Trityl-PEG10-azide | Trityl-PEG10-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Trityl-PEG10-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||