95415-91-1
Chemical Structure
SCH 34343
- CAS No.: 95415-91-1
- Formula:C11H14N2O6S2
- Molecular Weight:334.37
IUPAC Name: (5R,6S)-3-((2-(carbamoyloxy)ethyl)thio)-6-((R)-1-hydroxyethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid
InChIKey: LVCPLOQIOKEULU-GLDDHUGJSA-N
SMILES: O=C(C(N12)=C(SCCOC(N)=O)S[C@]2([H])[C@@H]([C@H](O)C)C1=O)O
Biological Activity: SCH 34343 is a penem antibiotic. SCH 34343 is highly active against Streptococcus pneumoniae (MIC50 ≤ 0.015 mg/L), viridans streptococci (MIC50 = 0.06 mg/L), streptococci of groups A (MIC50 = 0.03 mg/L), B (MIC50 = 0.06 mg/L), C and G (MIC50 = 0.03 mg/L), and Str. bovis. SCH 34343 can be used for antibacterial research[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
SCH 34343 | SCH 34343 is a penem antibiotic. SCH 34343 is highly active against Streptococcus pneumoniae (MIC50 ≤ 0.015 mg/L), viridans streptococci (MIC50 = 0.06 mg/L), streptococci of groups A (MIC50 = 0.03 mg/L), B (MIC50 = 0.06 mg/L), C and G (MIC50 = 0.03 mg/L), and Str. bovis. SCH 34343 can be used for antibacterial research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
