97180-26-2
Chemical Structure
(E)-Cefodizime
Synonym(s): (E)-THR-221
- CAS No.: 97180-26-2
- Formula:C20H20N6O7S4
- Molecular Weight:584.67
IUPAC Name: (6R,7R)-7-((E)-2-(2-aminothiazol-4-yl)-2-(methoxyimino)acetamido)-3-(((5-(carboxymethyl)-4-methylthiazol-2-yl)thio)methyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
InChIKey: XDZKBRJLTGRPSS-ZSKFQXOHSA-N
SMILES: OC(C1=C(CSC2=NC(C)=C(CC(O)=O)S2)CS[C@@]3([H])N1C([C@@]3([H])NC(/C(C4=CSC(N)=N4)=N/OC)=O)=O)=O
Biological Activity: (E)-Cefodizime ((E)-THR-221) is an antibiotic. (E)-Cefodizime can selectively bind to penicillin-binding proteins (PBPs) and inhibit the synthesis of the bacterial cell wall, thereby exerting antibacterial activity. (E)-Cefodizime is promising for research of various bacterial infectious diseases, such as for preoperative infection prophylaxis[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(E)-Cefodizime | (E)-Cefodizime ((E)-THR-221) is an antibiotic. (E)-Cefodizime can selectively bind to penicillin-binding proteins (PBPs) and inhibit the synthesis of the bacterial cell wall, thereby exerting antibacterial activity. (E)-Cefodizime is promising for research of various bacterial infectious diseases, such as for preoperative infection prophylaxis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||