108694-93-5
108694-93-5
Chemical Structure
Guanidine-d5 hydrochloride
Synonym(s): Guanidinium-d5 chloride; Aminoformamidine-d5 hydrochloride
- CAS No.: 108694-93-5
- Formula:CD6ClN3
- Molecular Weight:101.57
IUPAC Name: 2-(ethyl-d5)hexan-1,1,2,3,3,4,4,5,5,6,6,6-d12-1-ol
InChIKey: PJJJBBJSCAKJQF-YIKVAAQNSA-N
SMILES: [2H]/N=C(N([2H])[2H])/N([2H])[2H].Cl[2H]
Biological Activity: Guanidine-d5 hydrochloride (Guanidinium-d5 chloride) is the d5-labeled Guanidine hydrochloride (HY-B0178A). Guanidine hydrochloride is a strong protein denaturant. Guanidine hydrochloride causes proteins to assume a random coil conformation[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Guanidine-d5 hydrochloride | 98% | Guanidine-d5 hydrochloride (Guanidinium-d5 chloride) is the d5-labeled Guanidine hydrochloride (HY-B0178A). Guanidine hydrochloride is a strong protein denaturant. Guanidine hydrochloride causes proteins to assume a random coil conformation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Guanidine hydrochloride (Standard) | ≥98% | Guanidine hydrochloride (Standard) (Guanidinium chloride (Standard)) is the analytical standard of Guanidine hydrochloride (HY-B0178A). This product is intended for research and analytical applications. Guanidine hydrochloride (Guanidinium chloride) is a strong protein denaturant. Guanidine hydrochloride causes proteins to assume a random coil conformation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Guanidine-13C,15N3 hydrochloride | Guanidine-13C,15N3 hydrochloride (Guanidinium-13C,15N3 (chloride)) is the 15N, 13C-labeled Guanidine hydrochloride (HY-B0178A). Guanidine hydrochloride is a strong protein denaturant. Guanidine hydrochloride causes proteins to assume a random coil conformation. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Guanidine-13C hydrochloride | Guanidine-13C hydrochloride (Guanidinium-13C chloride) is the 13C-labeled Guanidine hydrochloride (HY-B0178A). 6M Guanidine hydrochloride Solution (6M Guanidinium chloride Solution) is a strong protein denaturant. Guanidine hydrochloride is a strong protein denaturant. Guanidine hydrochloride causes proteins to assume a random coil conformation. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
6M Guanidine hydrochloride Solution | 98.0% | 6M Guanidine hydrochloride Solution (6M Guanidinium chloride Solution) is a strong protein denaturant. 6M Guanidine hydrochloride Solution causes proteins to assume a random coil conformation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Guanidine hydrochloride | 98.0% | Guanidine hydrochloride (Guanidinium chloride) is a strong protein denaturant. Guanidine hydrochloride causes proteins to assume a random coil conformation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
