171777-66-5
Chemical Structure
4-Nitrobenzoic acid-d4
- CAS No.: 171777-66-5
- Formula:C7HD4NO4
- Molecular Weight:171.14
IUPAC Name: 3,3'-(butane-1,4-diyl)bis(1-vinyl-1H-imidazol-3-ium) bis((trifluoromethyl)sulfonyl)amide
InChIKey: OTLNPYWUJOZPPA-RHQRLBAQSA-N
SMILES: O=C(O)C1=C([2H])C([2H])=C([N+]([O-])=O)C([2H])=C1[2H]
Biological Activity: 4-Nitrobenzoic acid-d4 is the deuterium labeled 4-Nitrobenzoic acid (HY-Y0607). 4-Nitrobenzoic acid is an oxidoreduction mediator and an electron transfer promoter. 4-Nitrobenzoic acid accepts electrons from the reduced glucose oxidase and transfers them to the electrode to promote the glucose oxidation reaction, while minimizing the formation of protonated amine groups[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
4-Nitrobenzoic acid-d4 | 4-Nitrobenzoic acid-d4 is the deuterium labeled 4-Nitrobenzoic acid (HY-Y0607). 4-Nitrobenzoic acid is an oxidoreduction mediator and an electron transfer promoter. 4-Nitrobenzoic acid accepts electrons from the reduced glucose oxidase and transfers them to the electrode to promote the glucose oxidation reaction, while minimizing the formation of protonated amine groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-Nitrobenzoic acid (Standard) | ≥98% | 4-Nitrobenzoic acid (Standard) is the analytical standard of 4-Nitrobenzoic acid (HY-Y0607). This product is intended for research and analytical applications. 4-Nitrobenzoic acid is an oxidoreduction mediator and an electron transfer promoter. 4-Nitrobenzoic acid accepts electrons from the reduced glucose oxidase and transfers them to the electrode to promote the glucose oxidation reaction, while minimizing the formation of protonated amine groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-Nitrobenzoic acid-d2 | 99% | 4-Nitrobenzoic acid-d2 is the deuterium labeled 4-Nitrobenzoic acid (HY-Y0607). 4-Nitrobenzoic acid acts as a redox mediator and electron transfer promoter. 4-Nitrobenzoic acid accepts electrons from reduced glucose oxidase and transfers them to the electrode to facilitate the glucose oxidation reaction, while minimizing the formation of protonated amino groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
4-Nitrobenzoic acid | 99.84% | 4-Nitrobenzoic acid is a nitroaromatic compound that can be used in the synthesis of other active compounds. 4-Nitrobenzoic acid is also an inhibitor agent, which can be used for the recognition of the Mycobacterium tuberculosis complex and differentiation from non-tuberculous mycobacteria. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||