1750-45-4
Chemical Structure
6-Hydroxy Chlorzoxazone
- CAS No.: 1750-45-4
- Formula:C7H4ClNO3
- Molecular Weight:185.56
IUPAC Name: 5-Chloro-6-hydroxybenzo[d]oxazol-2(3H)-one
InChIKey: AGLXDWOTVQZHIQ-UHFFFAOYSA-N
SMILES: ClC1=CC(N=C2O)=C(O2)C=C1O
Biological Activity: 6-Hydroxy Chlorzoxazone is a metabolite of Chlorzoxazone (HY-B1462). Chlorzoxazone is a centrally acting muscle relaxant used to treat muscle spasm and the resulting pain or discomfort[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
6-Hydroxy Chlorzoxazone | 99.02% | 6-Hydroxy Chlorzoxazone is a metabolite of Chlorzoxazone (HY-B1462). Chlorzoxazone is a centrally acting muscle relaxant used to treat muscle spasm and the resulting pain or discomfort. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
6-Hydroxy Chlorzoxazone (Standard) | ≥98% | 6-Hydroxy Chlorzoxazone (Standard) is the analytical standard of 6-Hydroxy Chlorzoxazone. This product is intended for research and analytical applications. 6-Hydroxy Chlorzoxazone is a metabolite of Chlorzoxazone (HY-B1462). Chlorzoxazone is a centrally acting muscle relaxant used to treat muscle spasm and the resulting pain or discomfort. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
6-Hydroxy Chlorzoxazone-15N,d2 | 96.54% | 6-Hydroxy Chlorzoxazone-15N,d2 is the 15N and deuterium labeled 6-Hydroxy Chlorzoxazone (HY-W016221). 6-Hydroxy Chlorzoxazone is a metabolite of Chlorzoxazone (HY-B1462). Chlorzoxazone is a centrally acting muscle relaxant used to treat muscle spasm and the resulting pain or discomfort. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
6-Hydroxy Chlorzoxazone-13C6 | 6-Hydroxy Chlorzoxazone-13C6 is a the 13C-labeled 6-Hydroxy Chlorzoxazone (HY-W016221). 6-Hydroxy Chlorzoxazone is a metabolite of Chlorzoxazone (HY-B1462). Chlorzoxazone is a centrally acting muscle relaxant used to treat muscle spasm and the resulting pain or discomfort. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||