1965272-23-4
Chemical Structure
Derrisaponin B
- CAS No.: 1965272-23-4
- Formula:C56H88O26
- Molecular Weight:1177.28
InChIKey: MALDKKTZOXXJKE-TZRJQRAHSA-N
SMILES: C[C@]12[C@@](CC=C3[C@]2(CC[C@@]4([C@@]3([H])C[C@](C)(C[C@H]4OC(C)=O)C(O[C@@H]5O[C@@H]([C@H]([C@@H]([C@H]5O)O)O)CO)=O)C)C)([H])[C@@]6([C@@]([C@](C)([C@H](CC6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)C(O)=O)O)O)O[C@H]8[C@@H]([C@H]([C@H]([C@H](O8)CO)O)O)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O)O)O)CO)([H])CC1)C
Biological Activity: Derrisaponin B is an oleanane-type triterpenoid saponin and sweetener found in the stems of Derris eriocarpa How, with sweetness intensity approximately 2 times that of Sucrose (HY-B1779) at 1% concentration. Derrisaponin B exhibits sweet taste activity. Derrisaponin B can be used for research on hypertension, hyperglycemia, and obesity[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Derrisaponin B | Derrisaponin B is an oleanane-type triterpenoid saponin and sweetener found in the stems of Derris eriocarpa How, with sweetness intensity approximately 2 times that of Sucrose (HY-B1779) at 1% concentration. Derrisaponin B exhibits sweet taste activity. Derrisaponin B can be used for research on hypertension, hyperglycemia, and obesity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
